CAS 1492-52-0
:Z-Ser(Tos)-OMe
Description:
Z-Ser(Tos)-OMe, also known as Z-Serine methyl ester tosylate, is a chemical compound characterized by its protective groups that facilitate the synthesis of peptides and other organic molecules. The "Z" (benzyloxycarbonyl) group serves as a protective group for the amino group of serine, while the "Tos" (tosyl) group protects the hydroxyl group, enhancing the compound's stability and reactivity during chemical reactions. The methyl ester (OMe) form allows for easier handling and incorporation into larger molecular frameworks. This compound is typically used in peptide synthesis, where the protection of functional groups is crucial to prevent unwanted reactions. Z-Ser(Tos)-OMe is soluble in organic solvents, making it suitable for various synthetic applications. Its structure and functional groups enable selective reactions, which are essential in the development of pharmaceuticals and biologically active compounds. Overall, Z-Ser(Tos)-OMe is a valuable intermediate in organic synthesis, particularly in the field of medicinal chemistry.
Formula:C19H21NO7S
InChI:InChI=1/C19H21NO7S/c1-14-8-10-16(11-9-14)28(23,24)27-13-17(18(21)25-2)20-19(22)26-12-15-6-4-3-5-7-15/h3-11,17H,12-13H2,1-2H3,(H,20,22)/t17-/m0/s1
SMILES:Cc1ccc(cc1)S(=O)(=O)OC[C@@H](C(=O)OC)N=C(O)OCc1ccccc1
Synonyms:- methyl N-[(benzyloxy)carbonyl]-O-[(4-methylphenyl)sulfonyl]-L-serinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
L-Serine, O-[(4-methylphenyl)sulfonyl]-N-[(phenylmethoxy)carbonyl]-, methyl ester
CAS:Formula:C19H21NO7SPurity:98%Color and Shape:SolidMolecular weight:407.4375Z-O-4-Toluenesulfonyl-L-serine methyl ester
CAS:Z-O-4-Toluenesulfonyl-L-serine methyl ester is a new chemical substance that has been synthesized as a potential pharmaceutical formulation. It has been shown to have protective effects against ischemia reperfusion injury in rats, reducing the damage to muscle and other tissues caused by ischemia reperfusion. The mechanism of action may be due to glyceride release and creatine production, which can maintain perfusion during periods of ischemia. Z-O-4-Toluenesulfonyl-L-serine methyl ester has also been shown to be effective in preventing damage to platelets during induction of ischemia.Formula:C19H21NO7SPurity:Min. 95%Color and Shape:PowderMolecular weight:407.44 g/mol


