CAS 1492-61-1
:2-Fluoro-ADP
Description:
2-Fluoro-ADP, or 2-fluoroadenosine diphosphate, is a nucleotide analog characterized by the presence of a fluorine atom at the 2-position of the adenine base. This modification can influence its biochemical properties, particularly its interaction with enzymes and its role in cellular processes. The compound is typically involved in studies related to nucleotide metabolism and signaling pathways. As a diphosphate, it contains two phosphate groups, which are crucial for energy transfer and storage in biological systems. The fluorine substitution may enhance the stability of the molecule or alter its affinity for certain enzymes, making it a valuable tool in biochemical research. Additionally, 2-Fluoro-ADP can serve as a substrate or inhibitor in various enzymatic reactions, providing insights into the mechanisms of nucleotide function and metabolism. Its CAS number, 1492-61-1, is a unique identifier that facilitates its recognition in chemical databases and literature. Overall, 2-Fluoro-ADP is significant in the study of nucleotides and their roles in cellular biochemistry.
Formula:C10H14FN5O10P2
InChI:InChI=1/C10H14FN5O10P2/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(18)5(17)3(25-9)1-24-28(22,23)26-27(19,20)21/h2-3,5-6,9,17-18H,1H2,(H,22,23)(H2,12,14,15)(H2,19,20,21)/t3-,5-,6-,9-/m1/s1
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)nc(F)nc23)O1)O)O)OP(=O)(O)OP(=O)(O)O
Synonyms:- 2-Fluoro-adenosine diphosphate
- ADP-beta-F
- Adenosine 5'-(2-fluorodiphosphate)
- Betafadp
- Adenosine, 5'-(trihydrogen diphosphate), 2-fluoro-
- 2-Fluoroadenosine 5'-(Trihydrogen Diphosphate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Fluoro-ADP
CAS:2-Fluoro-ADP is a bioactive chemical.Formula:C10H14FN5O10P2Color and Shape:SolidMolecular weight:445.19
