CAS 1492-62-2
:2-fluoro-ATP
Description:
2-Fluoro-ATP, with the CAS number 1492-62-2, is a modified nucleotide that serves as an analog of adenosine triphosphate (ATP). Its structure features a fluorine atom substituted at the 2-position of the ribose sugar, which can influence its biochemical properties and interactions. This modification can affect the molecule's stability, reactivity, and ability to participate in enzymatic reactions. 2-Fluoro-ATP is often used in biochemical research to study ATP-dependent processes, as it can mimic ATP while potentially altering the kinetics and mechanisms of ATP-utilizing enzymes. The presence of the fluorine atom may also enhance the compound's resistance to hydrolysis, making it a useful tool in various experimental settings. Additionally, its role in signaling pathways and energy transfer processes can provide insights into cellular metabolism and regulation. Overall, 2-fluoro-ATP is a valuable compound in the field of biochemistry and molecular biology, facilitating the exploration of nucleotide functions and interactions.
Formula:C10H15FN5O13P3
InChI:InChI=1/C10H15FN5O13P3/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(18)5(17)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,17-18H,1H2,(H,22,23)(H,24,25)(H2,12,14,15)(H2,19,20,21)/t3-,5-,6-,9-/m1/s1
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)nc(F)nc23)O1)O)O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O
Synonyms:- 2-Fluoro-adenosine triphosphate
- Adenosine 5'-(tetrahydrogen triphosphate), 2-fluoro-
- 2-Fluoroadenosine 5'-(Tetrahydrogen Triphosphate)
- 2-Fluoro-ATP
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Adenosine5'-(tetrahydrogen triphosphate), 2-fluoro-
CAS:Formula:C10H15FN5O13P3Molecular weight:525.17152-Fluoroadenosine 5'-triphosphate sodium
CAS:2-Fluoroadenosine 5'-triphosphate sodium salt is an analog of adenosine 5'-triphosphate (ATP) that has been used as a target molecule in binding experiments to identify cells that express the ATP receptor. 2-Fluoroadenosine 5'-triphosphate sodium salt binds to the surface glycoprotein on target cells and is internalized by endocytosis, resulting in cell death. This drug has also been shown to be effective against cancer cells grown in culture.Formula:C10H15FN5O13P3•Na3Purity:Min. 95%Color and Shape:PowderMolecular weight:594.12 g/mol

