CymitQuimica logo

CAS 149204-50-2

:

N(delta)-(5-methyl-4-oxo-2-imidazolin-2-yl)ornithine

Description:
N(delta)-(5-methyl-4-oxo-2-imidazolin-2-yl)ornithine, with the CAS number 149204-50-2, is a chemical compound that features a unique structure combining an ornithine backbone with an imidazolinone moiety. This compound is characterized by its potential biological activity, particularly in the context of biochemical pathways involving amino acids and nitrogen metabolism. The presence of the 5-methyl-4-oxo-2-imidazolin-2-yl group suggests that it may participate in various interactions due to its heterocyclic nature, which can influence its solubility and reactivity. Additionally, the ornithine component indicates that it may play a role in metabolic processes, possibly related to the urea cycle or polyamine synthesis. The compound's specific properties, such as melting point, solubility, and stability, would depend on its molecular interactions and the conditions under which it is studied. Overall, this compound represents an interesting subject for research in medicinal chemistry and biochemistry due to its structural features and potential applications.
Formula:C9H16N4O3
InChI:InChI=1/C9H16N4O3/c1-5-7(14)13-9(12-5)11-4-2-3-6(10)8(15)16/h5-6H,2-4,10H2,1H3,(H,15,16)(H2,11,12,13,14)/t5?,6-/m0/s1
SMILES:CC1C(=NC(=NCCC[C@@H](C(=O)O)N)N1)O
Synonyms:
  • Tu 185
  • N5-(4,5-Dihydro-4-methyl-5-oxo-1H-imidazol-2-yl)-L-ornithine
  • L-Ornithine, N5-(4,5-dihydro-4-methyl-5-oxo-1H-imidazol-2-yl)-
  • N~5~-(4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)-L-ornithine
  • N(delta)-(5-Methyl-4-oxo-2-imidazolin-2-yl)ornithine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.