CAS 14921-00-7
:2,4,6-tribromo-1,3,5-triazine
Description:
2,4,6-Tribromo-1,3,5-triazine is a heterocyclic organic compound characterized by its three nitrogen atoms and a triazine ring structure, which is substituted with three bromine atoms at the 2, 4, and 6 positions. This compound is typically a white to light yellow crystalline solid and is known for its stability and resistance to heat. It exhibits low solubility in water but is soluble in organic solvents, making it useful in various applications. The presence of bromine atoms enhances its flame-retardant properties, making it valuable in materials that require fire resistance. Additionally, 2,4,6-tribromo-1,3,5-triazine can act as a precursor in the synthesis of other chemical compounds and is utilized in agricultural chemistry as a pesticide. Its chemical stability and reactivity with nucleophiles also make it a subject of interest in synthetic organic chemistry. However, handling this compound requires caution due to its potential toxicity and environmental impact.
Formula:C3Br3N3
InChI:InChI=1/C3Br3N3/c4-1-7-2(5)9-3(6)8-1
SMILES:c1(Br)nc(Br)nc(Br)n1
Synonyms:- 2,4,6-Tribromo-S-Triazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
