CAS 14923-17-2
:Guanidine, N,N′′′-1,4-butanediylbis-, sulfate (1:1)
Description:
Guanidine, N,N′′′-1,4-butanediylbis-, sulfate (1:1), commonly referred to as guanidine sulfate, is an organic compound characterized by its guanidine backbone and a butanediyl linker. It is a white crystalline solid that is soluble in water, which makes it useful in various applications, including as a reagent in biochemical research and as a potential pharmaceutical intermediate. The presence of the sulfate group enhances its solubility and may influence its biological activity. Guanidine derivatives are known for their ability to act as strong bases and can participate in various chemical reactions, including nucleophilic substitutions. The compound may exhibit biological properties, such as antimicrobial or antiviral activity, although specific effects can vary based on concentration and context. Safety data indicates that, like many guanidine compounds, it should be handled with care due to potential toxicity. Overall, guanidine sulfate is a versatile compound with applications in both research and industry, warranting further investigation into its properties and potential uses.
Formula:C6H16N6·H2O4S
InChI:InChI=1S/C6H16N6.H2O4S/c7-5(8)11-3-1-2-4-12-6(9)10;1-5(2,3)4/h1-4H2,(H4,7,8,11)(H4,9,10,12);(H2,1,2,3,4)
InChI key:InChIKey=RWTGFMPOODRXIM-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)O.C(NC(=N)N)CCCNC(=N)N
Synonyms:- (E,E)-(butane-1,4-diyldinitrilo)bis(aminomethanaminium) sulfate
- 1,4-Diguanidinobutane sulfate
- 1-(4-Guanidinobutyl)guanidine sulfate
- 2,2'-Butane-1,4-Diyldiguanidine
- Arcaine sulfate
- Guanidine, 1,1′-tetramethylenedi-, sulfate (1:1)
- Guanidine, N,N′′′-1,4-butanediylbis-, sulfate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Guanidine, N,N'''-1,4-butanediylbis-, sulfate (1:1)
CAS:Formula:C6H18N6O4SPurity:95%Color and Shape:SolidMolecular weight:270.3099Arcaine sulfate
CAS:Arcaine sulfate is a NMDA antagonist.Formula:C6H18N6O4SPurity:99.95%Color and Shape:SolidMolecular weight:270.31Arcaine Sulfate
CAS:<p>Antagonist of NMDA receptor</p>Formula:C6H16N6·H2SO4Purity:Min. 95%Molecular weight:270.31 g/molArcaine sulfate
CAS:<p>Arcaine sulfate is a high-quality reagent that is used as an intermediate in the production of various fine chemicals, such as pharmaceuticals and dyes. Arcaine sulfate is also a useful scaffold in organic chemistry to synthesize other compounds, while being a versatile building block. The CAS number for this compound is 14923-17-2. Arcaine sulfate can be used in reactions as a reaction component, which makes it useful for research purposes.</p>Formula:C6H18N6O4SMolecular weight:270.31 g/molArcaine Sulfate
CAS:Controlled Product<p>Applications Arcaine sulfate is a novel and potent antagonist of the polyamine site on the NMDA receptor.<br>References Beraki, S. et al.: PLoS One, 8, e69233 (2013); Huang, M. et al.: Annals. New. York. Acad. Sci., 1009, 52 (2003);<br></p>Formula:C6H16N6·H2O4SColor and Shape:NeatMolecular weight:270.31






