CAS 149246-87-7
:5-PYRIDIN-3-YL-2H-PYRAZOL-3-YLAMINE
Description:
5-Pyridin-3-yl-2H-pyrazol-3-ylamine is an organic compound characterized by its unique structural features, which include a pyridine ring and a pyrazole moiety. The presence of the pyridine ring contributes to its aromatic properties, while the pyrazole structure adds to its potential reactivity and biological activity. This compound typically exhibits moderate to high solubility in polar solvents due to the presence of nitrogen atoms, which can engage in hydrogen bonding. It may also display basic properties owing to the nitrogen atoms in both the pyridine and pyrazole rings. The compound's potential applications could span various fields, including medicinal chemistry, where it may serve as a scaffold for drug development, particularly in targeting specific biological pathways. Additionally, its unique structure may allow for interactions with various biological targets, making it of interest in pharmacological studies. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, which could be leveraged in materials science or catalysis.
Formula:C8H8N4
InChI:InChI=1/C8H8N4/c9-8-4-7(11-12-8)6-2-1-3-10-5-6/h1-5H,(H3,9,11,12)
SMILES:c1cc(cnc1)c1cc(=N)[nH][nH]1
Synonyms:- Chembrdg-Bb 4010167
- 3-Pyridin-3-yl-1H-pyrazol-5-amine
- 5-pyridin-3-yl-1H-pyrazol-3-amine
- 5-(3-pyridinyl)-1H-Pyrazol-3-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Pyridin-3-yl-2H-pyrazol-3-ylamine
CAS:Formula:C8H8N4Purity:95%Color and Shape:SolidMolecular weight:160.17595-(Pyridin-3-yl)-1H-pyrazol-3-amine
CAS:5-(Pyridin-3-yl)-1H-pyrazol-3-aminePurity:95%Molecular weight:160.18g/mol5-Pyridin-3-yl-2H-pyrazol-3-ylamine
CAS:5-Pyridin-3-yl-2H-pyrazol-3-ylamine is a fine chemical with applications in the research and development of pharmaceuticals, agrochemicals, and other speciality chemicals. 5-Pyridin-3-yl-2H-pyrazol-3-ylamine is also a versatile building block for the synthesis of complex molecules. This compound can be used as a reagent or intermediate in organic reactions. It is also an excellent scaffold for the synthesis of complex molecules.Formula:C8H8N4Purity:Min. 95%Color and Shape:Off-white to pale yellow or beige solid.Molecular weight:160.18 g/mol3-Pyridin-3-yl-1H-pyrazol-5-amine
CAS:Formula:C8H8N4Purity:95%Color and Shape:SolidMolecular weight:160.18



