CAS 14926-08-0
:Benzoic acid, 4-amino-, magnesium salt (2:1)
Description:
Benzoic acid, 4-amino-, magnesium salt (2:1), also known by its CAS number 14926-08-0, is a chemical compound that features a benzoic acid structure with an amino group at the para position relative to the carboxylic acid group. This compound is characterized by its coordination with magnesium ions, forming a salt that typically exhibits properties associated with both organic acids and metal salts. It is generally soluble in water and may display buffering capacity due to the presence of the carboxylic acid group. The magnesium salt form can enhance the bioavailability of the benzoic acid derivative, making it of interest in various applications, including pharmaceuticals and agriculture. Additionally, the compound may exhibit antimicrobial properties, which can be beneficial in food preservation and other industrial applications. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the specific characteristics can vary based on purity and formulation.
Formula:C7H7NO2Mg
InChI:InChI=1S/C7H7NO2.Mg/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,8H2,(H,9,10);
InChI key:InChIKey=SAFKRMISPOEGRV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(N)C=C1.[Mg]
Synonyms:- Benzoic acid, 4-amino-, magnesium salt (2:1)
- Benzoic acid, p-amino-, magnesium salt (2:1)
- Magnesium Bis(4-Aminobenzoate)
- Magnesium p-aminobenzoate
- Magnesium, bis(p-aminobenzoato)-
- Reactyl
- p-Aminobenzoic acid magnesium salt
- Magnesium bis-p-aminobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Benzoic acid, 4-amino-, magnesium salt (2:1)
CAS:Formula:C14H12MgN2O4Purity:95%Color and Shape:SolidMolecular weight:296.5611Magnesium 4-aminobenzoate
CAS:<p>Magnesium 4-aminobenzoate is a chemical compound that is used as a reaction component or reagent in organic synthesis. It has a high quality and can be used for research purposes. Magnesium 4-aminobenzoate is versatile and can be used as an intermediate in the preparation of complex compounds, such as pharmaceuticals and agrochemicals.</p>Formula:C14H12MgN2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:296.56 g/mol
