CymitQuimica logo

CAS 149270-12-2

:

D-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-

Description:
D-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]- is a derivative of the amino acid cysteine, characterized by the presence of a carboxylic acid group and a thiol (-SH) functional group, which are typical of cysteine. The compound features a protective group, specifically the N-[(1,1-dimethylethoxy)carbonyl] moiety, which is used to enhance stability and solubility during chemical reactions or synthesis processes. This modification can influence the compound's reactivity, making it useful in peptide synthesis and other organic transformations. D-Cysteine itself is an important building block in biochemistry, playing a crucial role in protein structure and function due to its ability to form disulfide bonds. The presence of the dimethylethoxy group suggests that this compound may exhibit increased lipophilicity, potentially affecting its biological activity and interaction with cellular systems. Overall, D-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]- is a valuable compound in both synthetic organic chemistry and biochemistry, with applications in drug development and peptide synthesis.
Formula:C8H15NO4S
InChI:InChI=1S/C8H15NO4S/c1-8(2,3)13-7(12)9-5(4-14)6(10)11/h5,14H,4H2,1-3H3,(H,9,12)(H,10,11)/t5-/m1/s1
InChI key:ATVFTGTXIUDKIZ-RXMQYKEDSA-N
SMILES:CC(C)(C)OC(=O)N[C@H](CS)C(=O)O
Synonyms:
  • N-Boc-D-cysteine
Found 4 products.