CAS 149282-22-4
:3-(3,4-DICHLOROPHENYL)-1-(4-FLUOROBENZYL)-1-METHOXYUREA
Description:
3-(3,4-Dichlorophenyl)-1-(4-fluorobenzyl)-1-methoxyurea, identified by its CAS number 149282-22-4, is a synthetic organic compound characterized by its urea functional group, which is linked to a methoxy group and two aromatic rings. The presence of the dichlorophenyl and fluorobenzyl substituents contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of herbicides or other agrochemicals. This compound is typically solid at room temperature and exhibits moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic groups. The dichlorophenyl moiety may enhance its lipophilicity, influencing its interaction with biological membranes. Additionally, the presence of halogen atoms can affect the compound's reactivity and stability. As with many synthetic compounds, safety and handling precautions are essential, as it may pose risks if ingested or improperly handled. Further studies are often required to fully elucidate its properties and potential applications.
Formula:C15H13Cl2FN2O2
InChI:InChI=1/C15H13Cl2FN2O2/c1-22-20(9-10-2-4-11(18)5-3-10)15(21)19-12-6-7-13(16)14(17)8-12/h2-8H,9H2,1H3,(H,19,21)
SMILES:CON(Cc1ccc(cc1)F)C(=Nc1ccc(c(c1)Cl)Cl)O
Synonyms:- 3-(3,4-Dichlorophenyl)-1-(4-fluorobenzyl)-1-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(3,4-Dichlorophenyl)-1-(4-fluorobenzyl)-1-methoxyurea
CAS:Formula:C15H13Cl2FN2O2Molecular weight:343.1803
