CAS 149288-35-7

4-[(2,3,5-Trimethylphenoxy)methyl]benzoic acid

Description:

4-[(2,3,5-Trimethylphenoxy)methyl]benzoic acid, identified by its CAS number 149288-35-7, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming salts or esters. The presence of the 2,3,5-trimethylphenoxy group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit properties such as moderate to high melting points and stability under standard conditions, making it suitable for various applications in organic synthesis and materials science. Its structural features suggest potential uses in pharmaceuticals, agrochemicals, or as an intermediate in chemical manufacturing. Additionally, the presence of multiple methyl groups can affect its steric hindrance and reactivity, which may be relevant in specific chemical reactions or interactions. Overall, this compound's unique structure and functional groups contribute to its diverse potential applications in chemistry and related fields.

Formula: C₁₇H₁₈O₃

InChI: InChI=1S/C17H18O3/c1-11-8-12(2)13(3)16(9-11)20-10-14-4-6-15(7-5-14)17(18)19/h4-9H,10H2,1-3H3,(H,18,19)

InChI key: InChIKey=PCJQUWYBWXONLB-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(C(O)=O)C=C1)C2=C(C)C(C)=CC(C)=C2

Synonyms:

• 4-[(2,3,5-Trimethylphenoxy)methyl]benzoic acid
• Benzoic acid, 4-[(2,3,5-trimethylphenoxy)methyl]-

4-[(2,3,5-Trimethylphenoxy)methyl]benzoic acid

CAS: 149288-35-7

Versatile small molecule scaffold

Formula: C₁₇H₁₈O₃

Purity: Min. 95%

Molecular weight: 270.32 g/mol

Ref: 3D-ZFA28835