CAS 149288-65-3

4-[[(2,3-Dihydro-1H-inden-5-yl)oxy]methyl]benzoic acid

Description:

4-[[(2,3-Dihydro-1H-inden-5-yl)oxy]methyl]benzoic acid, with the CAS number 149288-65-3, is an organic compound characterized by its complex structure that includes a benzoic acid moiety and a dihydroindene group. This compound features a carboxylic acid functional group, which contributes to its acidity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The presence of the ether-like linkage (the -O-CH2- group) between the dihydroindene and the benzoic acid structure suggests potential reactivity and interactions in various chemical environments. The dihydroindene portion may impart unique steric and electronic properties, influencing the compound's behavior in biological systems or as a ligand in coordination chemistry. Additionally, the compound's structural features may allow for specific interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's characteristics suggest potential applications in pharmaceuticals or materials science, although specific properties such as melting point, boiling point, and solubility would require empirical measurement for precise characterization.

Formula: C₁₇H₁₆O₃

InChI: InChI=1S/C17H16O3/c18-17(19)14-6-4-12(5-7-14)11-20-16-9-8-13-2-1-3-15(13)10-16/h4-10H,1-3,11H2,(H,18,19)

InChI key: InChIKey=YIJFUZLNVSGATG-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(C(O)=O)C=C1)C=2C=C3C(=CC2)CCC3

Synonyms:

• Benzoic acid, 4-[[(2,3-dihydro-1H-inden-5-yl)oxy]methyl]-
• 4-[[(2,3-Dihydro-1H-inden-5-yl)oxy]methyl]benzoic acid

4-[(2,3-Dihydro-1H-inden-5-yloxy)methyl]benzoic acid

CAS: 149288-65-3

Versatile small molecule scaffold

Formula: C₁₇H₁₆O₃

Purity: Min. 95%

Molecular weight: 268.31 g/mol

Ref: 3D-ZFA28865