CymitQuimica logo

CAS 149297-79-0

:

6-Amino-3,9-dihydro-2H-purin-2-one

Description:
6-Amino-3,9-dihydro-2H-purin-2-one, also known as a purine derivative, is characterized by its bicyclic structure that includes a fused imidazole and pyrimidine ring system. This compound features an amino group at the 6-position and a carbonyl group at the 2-position, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which facilitates its use in various chemical reactions and biological applications. The presence of the amino group suggests potential for hydrogen bonding, influencing its interactions in biological systems. This compound may exhibit properties relevant to nucleic acid metabolism and could serve as a precursor or intermediate in the synthesis of other biologically active molecules. Its CAS number, 149297-79-0, allows for precise identification in chemical databases, aiding in research and development within pharmaceutical and biochemical fields. Overall, 6-Amino-3,9-dihydro-2H-purin-2-one is of interest for its structural features and potential applications in medicinal chemistry.
Formula:C5H5N5O
InChI:InChI=1S/C5H5N5O/c6-3-2-4(8-1-7-2)10-5(11)9-3/h1H,(H4,6,7,8,9,10,11)
InChI key:InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N
SMILES:NC=1C2=C(NC(=O)N1)NC=N2
Synonyms:
  • 2H-Purin-2-one, 6-amino-3,9-dihydro-
  • 6-Amino-3,9-dihydro-2H-purin-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.