CAS 149340-93-2

N-[2-(4-Nitrophenyl)ethyl]-N'-propylurea

Description:

N-[2-(4-Nitrophenyl)ethyl]-N'-propylurea, with the CAS number 149340-93-2, is a chemical compound characterized by its urea functional group, which is central to its structure. This compound features a propyl group and a 4-nitrophenyl group attached to a 2-ethyl chain, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the nitro group suggests that it may have significant electronic effects, potentially influencing its reactivity and interactions with biological systems. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as a chemical intermediate. Safety data should be consulted for handling, as nitro compounds can sometimes be hazardous. Overall, N-[2-(4-Nitrophenyl)ethyl]-N'-propylurea represents a versatile structure with potential utility in research and industry.

Formula: C₁₂H₁₇N₃O₃

InChI: InChI=1/C12H17N3O3/c1-2-8-13-12(16)14-9-7-10-3-5-11(6-4-10)15(17)18/h3-6H,2,7-9H2,1H3,(H2,13,14,16)

SMILES: CCCN=C(NCCc1ccc(cc1)N(=O)=O)O

Synonyms:

• N-[2-(4-nitrophenyl)ethyl]-N'-propyl-Urea
• Urea, N-[2-(4-nitrophenyl)ethyl]-N'-propyl-
• 1-[2-(4-Nitrophenyl)Ethyl]-3-Propylurea
• 1-(4-Nitrophenethyl)-3-propylurea

1-(4-Nitrophenethyl)-3-propylurea

CAS: 149340-93-2

Formula: C₁₂H₁₇N₃O₃

Molecular weight: 251.2817

Ref: IN-DA001LLC