CAS 149365-40-2: 4-(phthalazin-1-yloxy)aniline

Description: 4-(Phthalazin-1-yloxy)aniline, with the CAS number 149365-40-2, is an organic compound characterized by its structural features, which include a phthalazin moiety linked to an aniline group via an ether bond. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The phthalazin ring contributes to its stability and may influence its electronic properties, making it of interest in various chemical applications, including pharmaceuticals and materials science. Additionally, the compound may exhibit biological activity, which could be explored in medicinal chemistry contexts. Its synthesis often involves standard organic reactions, such as nucleophilic substitution or coupling reactions, and it may be characterized using techniques like NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, 4-(phthalazin-1-yloxy)aniline represents a versatile building block in organic synthesis and research.

Formula: C₁₄H₁₁N₃O

InChI: InChI=1/C14H11N3O/c15-11-5-7-12(8-6-11)18-14-13-4-2-1-3-10(13)9-16-17-14/h1-9H,15H2

4-(Phthalazin-1-yloxy)aniline

CAS: 149365-40-2

4-(Phthalazin-1-yloxy)aniline is an analog of cyclin-dependent kinase (CDK) inhibitors that has shown promising anticancer activity. …

• Formula: C₁₄H₁₁N₃O
• Purity: Min. 95%
• Molecular weight: 237.26 g/mol

4-(Phthalazin-1-yloxy)aniline

CAS: 149365-40-2

• Purity: 98%
• Molecular weight: 237.26199340820312