CAS 149400-88-4
:4-amidinoindan-1-one 2'-amidinohydrazone
Description:
4-Amidinoindan-1-one 2'-amidinohydrazone is a chemical compound characterized by its unique structural features, which include an indanone core and amidino functional groups. This compound typically exhibits properties associated with both hydrazones and amidines, such as potential biological activity and the ability to form hydrogen bonds due to the presence of nitrogen-rich functional groups. It may display a range of solubility characteristics depending on the solvent used, often being more soluble in polar solvents. The compound's structure suggests it could participate in various chemical reactions, including condensation and nucleophilic addition, making it of interest in medicinal chemistry and drug development. Additionally, its potential applications may extend to areas such as biochemistry and pharmacology, where it could serve as a lead compound for further modifications aimed at enhancing its efficacy or selectivity. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C11H14N6
InChI:InChI=1/C11H14N6/c12-10(13)8-3-1-2-7-6(8)4-5-9(7)16-17-11(14)15/h1-3H,4-5H2,(H3,12,13)(H4,14,15,17)/b16-9+
Synonyms:- Sardomozide [INN]
- 4-Aiah
- Cgp 48664
- Sam 486A
- Sardomozide
- Urea azine with 1-oxo-4-indancarboxamidine
- Hydrazinecarboximidamide, 2-(4-(aminoiminomethyl)-2,3-dihydro-1H-inden-1-ylidene)-
- (1E)-1-[(diaminomethylidene)hydrazinylidene]-2,3-dihydro-1H-indene-4-carboximidamide
- 4-Amidinoindan-1-one 2'-amidinohydrazone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Hydrazinecarboximidamide, 2-[4-(aminoiminomethyl)-2,3-dihydro-1H-inden-1-ylidene]-
CAS:Formula:C11H14N6Molecular weight:230.2691Sardomozide
CAS:Sardomozide is an inhibitor of S-adenosylmethionine decarboxylase (SAMDC)(IC50 of 5 nM).Formula:C11H14N6Purity:98%Color and Shape:SolidMolecular weight:230.27

