CAS 149409-57-4
:4-Methoxy-3-(2-phenylethoxy)-N,N-dipropylbenzeneethanamine hydrochloride (1:1)
Description:
4-Methoxy-3-(2-phenylethoxy)-N,N-dipropylbenzeneethanamine hydrochloride is a synthetic compound characterized by its complex molecular structure, which includes a methoxy group, a phenylethoxy moiety, and a dipropylamine functional group. This compound is typically classified as an organic amine and may exhibit properties associated with psychoactive substances, although specific pharmacological effects can vary. The hydrochloride salt form indicates that it is a stable, water-soluble derivative, which is often used to enhance solubility and bioavailability in pharmaceutical applications. The presence of multiple aromatic rings suggests potential for significant interactions with biological targets, possibly influencing neurotransmitter systems. Its synthesis involves multi-step organic reactions, and it may be of interest in research related to neuropharmacology or medicinal chemistry. Safety and handling precautions are essential, as with any chemical substance, particularly those with psychoactive potential. As with all compounds, thorough characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity.
Formula:C23H33NO2·ClH
InChI:InChI=1S/C23H33NO2.ClH/c1-4-15-24(16-5-2)17-13-21-11-12-22(25-3)23(19-21)26-18-14-20-9-7-6-8-10-20;/h6-12,19H,4-5,13-18H2,1-3H3;1H
InChI key:InChIKey=ZHGMDXSHODHWHV-UHFFFAOYSA-N
SMILES:O(CCC1=CC=CC=C1)C2=C(OC)C=CC(CCN(CCC)CCC)=C2.Cl
Synonyms:- 4-Methoxy-3-(2-phenylethoxy)-N,N-dipropylbenzeneethanamine hydrochloride
- 4-Methoxy-3-(2-phenylethoxy)-N,N-dipropylbenzeneethanamine hydrochloride (1:1)
- Benzeneethanamine, 4-methoxy-3-(2-phenylethoxy)-N,N-dipropyl-, hydrochloride
- Benzeneethanamine, 4-methoxy-3-(2-phenylethoxy)-N,N-dipropyl-, hydrochloride (1:1)
- N,N-diethyl-2-[4-methoxy-3-(2-phenylethoxy)phenyl]ethanamine hydrochloride (1:1)
- N-{2-[4-methoxy-3-(2-phenylethoxy)phenyl]ethyl}-N-propylpropan-1-amine hydrochloride
- Ne 100
- N,N-Dipropyl-2-(4-methoxy-3-(2-phenylethoxy)phenyl)ethylamine monohydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
NE 100 Hydrochloride
CAS:Controlled Product<p>Applications NE-100 is a potent and selective σ1 receptor antagonist.<br>References Sabino, V., et al.: Psychopharmacology, 205, 327 (2009); Kunitachi, S., et al.: Brain Res., 1279, 189 (2009)<br></p>Formula:C23H34ClNO2Color and Shape:NeatMolecular weight:391.98NE-100
CAS:<p>NE-100 is an advanced enzyme formulation, which is derived from a genetically engineered microbial source with precise selectivity and stability. The mode of action involves the catalysis of specific biochemical reactions, facilitating substrate transformation with high efficiency and minimal by-product formation. NE-100's enzymatic activity is optimized for a range of temperatures and pH levels, making it versatile for various research and industrial applications.</p>Formula:C23H33NO2·HClPurity:Min. 95%Molecular weight:391.97 g/molNE-100 hydrochloride
CAS:NE-100 hydrochloride (NE-100 HCl) is a potent and selective antagonist of σ1 (IC50 = 4.16 nM) with antipsychotic activity.Formula:C23H34ClNO2Purity:99.76%Color and Shape:SolidMolecular weight:391.98




