CAS 14941-08-3: Poncirin
Description:Poncirin is a flavonoid glycoside primarily found in citrus fruits, particularly in the leaves and fruits of the Poncirus trifoliata plant. It is characterized by its chemical structure, which consists of a flavone backbone with a sugar moiety attached, typically rhamnose. This compound exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anti-cancer properties, making it of interest in pharmacological research. Poncirin is also known for its role in plant defense mechanisms and may contribute to the flavor and aroma profiles of citrus products. Its solubility in water is limited, which can affect its bioavailability and efficacy in biological systems. Additionally, Poncirin has been studied for its potential health benefits, including its ability to modulate metabolic processes and its effects on cardiovascular health. As research continues, the full range of its therapeutic applications and mechanisms of action is still being explored.
Formula:C28H34O14
InChI:InChI=1S/C28H34O14/c1-11-21(32)23(34)25(36)27(38-11)42-26-24(35)22(33)19(10-29)41-28(26)39-14-7-15(30)20-16(31)9-17(40-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-8,11,17,19,21-30,32-36H,9-10H2,1-2H3/t11-,17-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1
InChI key:InChIKey=NLAWPKPYBMEWIR-SKYQDXIQSA-N
SMILES:O=C1C2=C(O)C=C(OC3OC(CO)C(O)C(O)C3OC4OC(C)C(O)C(O)C4O)C=C2OC(C5=CC=C(OC)C=C5)C1
- Synonyms:
- 4H-1-Benzopyran-4-one, 7-[[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(4-methoxyphenyl)-, (2S)-
- Poncirin
- (2S)-7-[[2-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- Neohesperidoside, isosakuranetin-7
- 4H-1-Benzopyran-4-one, 7-[[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(4-methoxyphenyl)-, (S)-
