CAS 149423-77-8
:1-N-CBZ-TRANS-1,4-CYCLOHEXYLDIAMINE
Description:
1-N-CBZ-TRANS-1,4-CYCLOHEXYLDIAMINE, with the CAS number 149423-77-8, is a chemical compound characterized by its unique structure, which includes a cyclohexyl group and a carbobenzyloxy (CBZ) protecting group. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and biologically active molecules. The presence of the trans configuration in the cyclohexyl moiety contributes to its stereochemical properties, influencing its reactivity and interaction with biological targets. The CBZ group serves as a protective group for the amine functionality, allowing for selective reactions without affecting the amine. In terms of physical properties, it is generally a solid at room temperature, with solubility in organic solvents. The compound's reactivity is primarily attributed to the amine groups, which can participate in various chemical reactions, including acylation and coupling reactions. Overall, 1-N-CBZ-TRANS-1,4-CYCLOHEXYLDIAMINE is a valuable intermediate in synthetic organic chemistry, particularly in the development of complex molecules.
Formula:C14H20N2O2
InChI:InChI=1/C14H20N2O2/c15-12-6-8-13(9-7-12)16-14(17)18-10-11-4-2-1-3-5-11/h1-5,12-13H,6-10,15H2,(H,16,17)/t12-,13-
SMILES:c1ccc(cc1)COC(=N[C@H]1CC[C@@H](CC1)N)O
Synonyms:- N-Cbz-Trans-1,4-Cyclohexanediamine
- Trans-(4-Amino-Cyclohexyl)-Carbamic Acid Benzyl Ester
- Benzyl (Trans-4-Aminocyclohexyl)Carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
trans-4-(Benzyloxycarbonylamino)cyclohexylamine, 97%
CAS:<p>trans-4-(Benzyloxycarbonylamino)cyclohexylamine is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / it</p>Formula:C14H20N2O2Purity:97%Molecular weight:248.32Carbamic acid, N-(trans-4-aminocyclohexyl)-, phenylmethyl ester
CAS:Formula:C14H20N2O2Purity:97%Color and Shape:SolidMolecular weight:248.3208Benzyl (Trans-4-Aminocyclohexyl)Carbamate
CAS:Benzyl (Trans-4-Aminocyclohexyl)CarbamatePurity:99%Molecular weight:248.32g/molN-Cbz-trans-1,4-cyclohexanediamine
CAS:Formula:C14H20N2O2Purity:99%Color and Shape:PowderMolecular weight:248.326



