CAS 14943-47-6
:vasopressin, N-(N-Gly-Gly)-8-Lys-
Description:
Vasopressin, N-(N-Gly-Gly)-8-Lys- is a synthetic analog of the naturally occurring antidiuretic hormone vasopressin, which plays a crucial role in regulating water retention in the body and maintaining blood pressure. This specific compound features modifications that enhance its biological activity and stability. The presence of the N-Gly-Gly moiety and the substitution at the 8th position with lysine contribute to its pharmacological properties, making it useful in various therapeutic applications, particularly in treating conditions like diabetes insipidus and certain types of shock. The molecular structure typically includes a peptide backbone, which is characteristic of peptide hormones, and its activity is mediated through specific receptors in the kidneys and vascular system. As a synthetic derivative, it may exhibit improved potency or altered pharmacokinetics compared to the native hormone. Overall, this compound exemplifies the importance of structural modifications in enhancing the therapeutic efficacy of peptide-based drugs.
Formula:C50H71N15O14S2
InChI:InChI=1/C50H71N15O14S2/c51-17-5-4-9-30(43(72)57-23-40(55)69)60-49(78)37-10-6-18-65(37)50(79)36-26-81-80-25-35(58-42(71)24-56-41(70)22-52)48(77)62-33(20-28-11-13-29(66)14-12-28)46(75)61-32(19-27-7-2-1-3-8-27)45(74)59-31(15-16-38(53)67)44(73)63-34(21-39(54)68)47(76)64-36/h1-3,7-8,11-14,30-37,66H,4-6,9-10,15-26,51-52H2,(H2,53,67)(H2,54,68)(H2,55,69)(H,56,70)(H,57,72)(H,58,71)(H,59,74)(H,60,78)(H,61,75)(H,62,77)(H,63,73)(H,64,76)/t30-,31-,32+,33-,34-,35-,36-,37-/m0/s1
Synonyms:- Triglycyl-desglycine amide lysine vasopressin
- N-(N-Glycylglycyl)-8-lysine vasopressin
- Vasopressin, N-(N-gly-gly)-8-lys-
- Vasopressin, N-(N-glycylglycyl)-8-L-lysine-
- Vasopressin, N-(N-glycylglycyl)-8-lysine-
- 1-{[(4R,7S,10S,13R,16S,19R)-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-19-[(glycylglycyl)amino]-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-L-lysylglycinamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Terlipressin EP Impurity A Ditrifluoroacetate (Des-1-Glycine-Terlipressin Ditrifluoroacetate)
CAS:Formula:C50H71N15O14S2·2C2HF3O2Molecular weight:1170.33 2*114.02
