CAS 14943-53-4

4-(diethylamino)but-2-yn-1-yl hydroxy(diphenyl)acetate

Description:

4-(Diethylamino)but-2-yn-1-yl hydroxy(diphenyl)acetate, with the CAS number 14943-53-4, is a chemical compound that features a unique structure characterized by the presence of a butynyl group, a diethylamino moiety, and a hydroxy(diphenyl)acetate functional group. This compound is likely to exhibit properties typical of both amines and esters, including potential solubility in organic solvents and varying degrees of polarity. The diethylamino group may impart basicity and influence the compound's reactivity, while the hydroxy(diphenyl)acetate portion could contribute to its potential as a ligand or in biological applications. The presence of the alkyne functional group suggests that it may participate in various chemical reactions, such as cycloadditions or nucleophilic attacks. Additionally, the compound's structure may allow for interesting interactions with biological systems, making it a candidate for further investigation in medicinal chemistry or materials science. Overall, its unique combination of functional groups suggests diverse applications and reactivity profiles.

Formula: C₂₂H₂₅NO₃

InChI: InChI=1/C22H25NO3/c1-3-23(4-2)17-11-12-18-26-21(24)22(25,19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-10,13-16,25H,3-4,17-18H2,1-2H3

SMILES: CCN(CC)CC#CCOC(=O)C(c1ccccc1)(c1ccccc1)O

α-Descyclohexyl-α-phenyl Oxybutynin

CAS: 14943-53-4

Formula: C₂₂H₂₅NO₃

Color and Shape: Solid

Molecular weight: 351.4388

Ref: IN-DA001LP3

Oxybutynin EP Impurity B

CAS: 14943-53-4

Formula: C₂₂H₂₅NO₃

Color and Shape: White To Off-White Solid

Molecular weight: 351.45

Ref: 4Z-O-0713

Oxybutynin Hydrochloride EP Impurity B

Controlled Product

CAS: 14943-53-4

Formula: C₂₂H₂₅NO₃

Color and Shape: Neat

Molecular weight: 351.44

Ref: 86-MM0047.06

Oxybutynin EP Impurity B

CAS: 14943-53-4

Formula: C₂₂H₂₅NO₃

Molecular weight: 351.45

Ref: ST-EA-CP-O14002

a-Descyclohexyl-a-phenyl Oxybutynin

Controlled Product

CAS: 14943-53-4

Impurity Oxybutynin EP Impurity B
Applications α-Descyclohexyl-α-phenyl Oxybutynin (Oxybutynin EP Impurity B) is an Oxybutynin impurity; 4-(dialkylamino)-2-butynyl benzilates as parasympatholytic substances.
References Dahlbom, R., et al.: Acta Chem. Scand., 17, 2354 (1963),

Formula: C₂₂H₂₅NO₃

Color and Shape: Neat

Molecular weight: 351.44

Ref: TR-D288840

Oxybutynin EP impurity B

CAS: 14943-53-4

Oxybutynin EP impurity B is a metabolite of oxybutynin and is a natural product. It is used as an analytical reference substance, to develop new drugs, and in pharmacopoeia in order to measure the purity of oxybutynin. The compound is synthesized by chemical synthesis and can be used as a standard for HPLC analysis.

Purity: Min. 95%

Ref: 3D-FO171020