CAS 14944-34-4
:Taiwanin C
Description:
Taiwanin C is a natural compound classified as a flavonoid, specifically a flavone, which is derived from various plant sources, particularly those found in Taiwan. It is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties. The molecular structure of Taiwanin C features a chromone backbone, which is characteristic of flavonoids, and it may exhibit various functional groups that contribute to its reactivity and biological effects. This compound has garnered interest in pharmacological research due to its ability to modulate cellular pathways and its potential therapeutic applications. Additionally, Taiwanin C may interact with different enzymes and receptors, influencing metabolic processes. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and potential medicinal use. Overall, Taiwanin C represents a significant area of study within natural product chemistry and pharmacognosy, highlighting the importance of plant-derived compounds in drug discovery and development.
Formula:C20H12O6
InChI:InChI=1S/C20H12O6/c21-20-19-12(7-22-20)3-11-5-16-17(26-9-25-16)6-13(11)18(19)10-1-2-14-15(4-10)24-8-23-14/h1-6H,7-9H2
InChI key:InChIKey=YMGOOHXUOWZQOE-UHFFFAOYSA-N
SMILES:O=C1C2=C(C3=C(C=C2CO1)C=C4C(=C3)OCO4)C=5C=C6C(=CC5)OCO6
Synonyms:- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one, 5-(1,3-benzodioxol-5-yl)-
- 5-(1,3-Benzodioxol-5-yl)furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one, 5-[3,4-(methylenedioxy)phenyl]-
- Taiwanin C
- Furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one,5-[3,4-(methylenedioxy)phenyl]- (8CI)
- Furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one, 5-(1,3-benzodioxol-5-yl)-
- 6,7-(Epoxymethanoxy)-9-(1,3-benzodioxole-5-yl)-1,3-dihydronaphtho[2,3-c]furan-1-one
- 5-(1,3-Benzodioxol-5-yl)furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6,7-(Epoxymethanoxy)-9-(1,3-benzodioxole-5-yl)-1,3-dihydronaphtho[2,3-c]furan-1-one
CAS:Formula:C20H12O6Purity:97.5%Molecular weight:348.3057Taiwanin C
CAS:Taiwanin C, a lignan from Cryptocarya chinensis, boasts anti-inflammatory, antioxidant, and anticancer properties.
Formula:C20H12O6Purity:98%Color and Shape:SolidMolecular weight:348.31Taiwanin C
CAS:Taiwanin C is an analog of dabigatran, a potent inhibitor of kinases that has been shown to have anticancer properties. It has been found to inhibit the growth of tumor cells in vitro and in vivo, inducing apoptosis and reducing protein expression. Taiwanin C has also shown promising results in inhibiting the activity of various kinases involved in cancer cell proliferation and survival. This compound is derived from Chinese herbal medicine and can be detected in urine after administration. Its potential as an anticancer agent makes it a promising area for further research into new cancer therapies.
Formula:C20H12O6Purity:Min. 95%Molecular weight:348.3 g/mol



