CymitQuimica logo

CAS 149463-07-0

:

2-(Chloromethyl)-3-fluoropyridine Hydrochloride

Description:
2-(Chloromethyl)-3-fluoropyridine Hydrochloride is a chemical compound characterized by its pyridine ring structure, which includes a chloromethyl group and a fluorine atom at specific positions. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The chloromethyl group contributes to its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and the development of pharmaceuticals. The fluorine atom can enhance the lipophilicity and metabolic stability of potential drug candidates. As with many halogenated compounds, it may exhibit biological activity, and its handling requires caution due to potential toxicity and environmental impact. Proper safety measures should be observed when working with this substance, including the use of personal protective equipment and adherence to relevant regulations regarding hazardous materials.
Formula:C6H5ClFNHCL
InChI:InChI=1S/C6H5ClFN.ClH/c7-4-6-5(8)2-1-3-9-6;/h1-3H,4H2;1H
InChI key:SBURMLFOEUIZGQ-UHFFFAOYSA-N
SMILES:C1=CC(=C(N=C1)CCl)F.Cl
Synonyms:
  • Pyridine, 2-(chloromethyl)-3-fluoro-, hydrochloride
Found 4 products.