CAS 149468-00-8

Formula: C6H2Cl2FNO2

InChI: InChI=1S/C6H2Cl2FNO2/c7-3-1-2(6(11)12)4(9)5(8)10-3/h1H,(H,11,12)

InChI key: LBFKRKJBMFOOBC-UHFFFAOYSA-N

SMILES: C1=C(C(=C(N=C1Cl)Cl)F)C(=O)O

2,6-Dichloro-3-fluoroisonicotinic acid

CAS: 149468-00-8

2,6-Dichloro-3-fluoroisonicotinic acid

Formula: C₆H₂Cl₂FNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 209.98998

Ref: 54-PC421103

2,6-Dichloro-3-fluoro-4-pyridinecarboxylic acid

CAS: 149468-00-8

Formula: C₆H₂Cl₂FNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 209.9900

Ref: IN-DA001LQ5

2,6-Dichloro-3-fluoroisonicotinic acid

CAS: 149468-00-8

2,6-Dichloro-3-fluoroisonicotinic acid

Formula: C₆H₂Cl₂FNO₂

Purity: 97%

Molecular weight: 209.99

Ref: IN-DG00965040

2,6-Dichloro-3-fluoroisonicotinic acid

CAS: 149468-00-8

Purity: 95%

Molecular weight: 209.9900055

Ref: 10-F622218

2,6-Dichloro-3-fluoropyridine-4-carboxylic acid

CAS: 149468-00-8

Versatile small molecule scaffold

Formula: C₆H₂Cl₂FNO₂

Purity: Min. 95%

Molecular weight: 209.99 g/mol

Ref: 3D-ZFA46800