CAS 14947-11-6

Magnesate(2-), [7,12-diethenyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-κN21,κN22,κN23,κN24]-, hydrogen (1:2), (SP-4-2)-

Description:

Magnesate(2-) with the specified name and CAS number 14947-11-6 is a complex chemical compound that features a porphyrin structure, which is characterized by a large, planar, cyclic arrangement of carbon and nitrogen atoms. This compound includes multiple substituents, such as diethenyl and dipropanoate groups, which contribute to its solubility and reactivity. The presence of magnesium as a central metal ion in the porphyrin ring is significant, as it plays a crucial role in the compound's electronic properties and potential applications in areas like catalysis or photochemistry. The specific coordination of the dipropanoate groups to the nitrogen atoms in the porphyrin enhances its stability and solubility in various solvents. Overall, this compound exemplifies the intricate relationship between metal coordination, organic functional groups, and the resulting chemical behavior, making it of interest in both synthetic and applied chemistry contexts.

Formula: C₃₄H₃₀MgN₄O₄·2H

InChI: InChI=1S/C34H34N4O4.Mg/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/b25-13-,26-13?,27-14?,28-15?,29-14-,30-15-,31-16-,32-16?;

InChI key: InChIKey=REJJDEGSUOCEEW-ADOXYXQCSA-L

SMILES: C(CC([O-])=O)C=1C=2[N-]3[Mg+2]45[N]6=C(C2)C(CCC([O-])=O)=C(C)C6=CC=7[N-]4C(C=C8[N]5=C(C=C3C1C)C(C=C)=C8C)=C(C=C)C7C.[H+]

Synonyms:

• Magnesate(2-), [7,12-diethenyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-N21,N22,N23,N24]-, dihydrogen, (SP-4-2)-
• Protoporphyrin IX, magnesium complex
• Magnesium, [dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropionato(2-)]-
• Magnesium, [dihydrogen protoporphyrin IX-ato(2-)]-
• Magnesate(2-), [7,12-diethenyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-κN21,κN22,κN23,κN24]-, hydrogen (1:2), (SP-4-2)-

Mg(II) protoporphyrin IX

CAS: 14947-11-6

Mg(II) protoporphyrin IX key in chlorophyll synthesis and regulates plant genes; used in plastid-nucleus signal research.

Formula: C₃₄H₃₂MgN₄O₄

Color and Shape: Solid

Molecular weight: 584.959

Ref: TM-T38980