CymitQuimica logo

CAS 14947-51-4

:

BIS(1,3-DITHIAN-2-YL)METHANE

Description:
BIS(1,3-DITHIAN-2-YL)METHANE, with the CAS number 14947-51-4, is an organic compound characterized by its unique structure, which features two 1,3-dithian-2-yl groups attached to a central methane unit. This compound is notable for its potential applications in organic synthesis and as a building block in the development of various chemical entities. The presence of the dithiane rings contributes to its reactivity, particularly in nucleophilic substitution reactions, due to the electron-donating properties of the sulfur atoms. Additionally, the compound may exhibit interesting properties such as solubility in organic solvents and stability under certain conditions, making it suitable for various laboratory applications. Its synthesis typically involves multi-step processes that may include the use of sulfur-containing reagents. As with many organosulfur compounds, BIS(1,3-DITHIAN-2-YL)METHANE may also display unique physical properties, including distinct melting and boiling points, which are influenced by its molecular structure and intermolecular interactions.
Formula:C9H16S4
InChI:InChI=1/C9H16S4/c1-3-10-8(11-4-1)7-9-12-5-2-6-13-9/h8-9H,1-7H2
SMILES:C1CSC(CC2SCCCS2)SC1
Synonyms:
  • 2,2'-Methylenebis-1,3-dithiane
  • 2,2'-Methylenebis-m-dithiane
  • Nsc 132850
  • 2,2'-Methanediylbis(1,3-Dithiane)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.