CAS 149490-61-9
:N-(Butylsulfonyl)-O-[4-(4-pyridinyl)butyl]-L-tyrosine
Description:
N-(Butylsulfonyl)-O-[4-(4-pyridinyl)butyl]-L-tyrosine, with the CAS number 149490-61-9, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a tyrosine backbone, which is an aromatic amino acid known for its role in protein synthesis and as a precursor for neurotransmitters. The presence of a butylsulfonyl group suggests that it has sulfonyl functional characteristics, which can enhance solubility and reactivity. Additionally, the incorporation of a pyridine moiety indicates potential interactions with biological targets, possibly influencing its pharmacological properties. The compound may exhibit unique properties such as increased lipophilicity due to the butyl chain, which can affect its bioavailability and distribution in biological systems. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C22H30N2O5S
InChI:InChI=1S/C22H30N2O5S/c1-2-3-16-30(27,28)24-21(22(25)26)17-19-7-9-20(10-8-19)29-15-5-4-6-18-11-13-23-14-12-18/h7-14,21,24H,2-6,15-17H2,1H3,(H,25,26)/t21-/m0/s1
InChI key:InChIKey=FRFFSBHFSQTHRE-NRFANRHFSA-N
SMILES:C([C@H](NS(CCCC)(=O)=O)C(O)=O)C1=CC=C(OCCCCC=2C=CN=CC2)C=C1
Synonyms:- <span class="text-smallcaps">L</span>-Tyrosine, N-(butylsulfonyl)-O-[4-(4-pyridinyl)butyl]-
- N-(Butylsulfonyl)-O-(4-(4-Piperidinyl)Butyl)-L-Tyrosine
- N-(Butylsulfonyl)-O-[4-(4-Piperidynyl)Butyl]-L-Tyrosine
- N-(Butylsulfonyl)-O-[4-(4-pyridinyl)butyl]-<span class="text-smallcaps">L</span>-tyrosine
- N-(Butylsulfonyl)-O-[4-Pyridin-4-Yl]Butyl]-L-Tyrosine
- L-Tyrosine, N-(butylsulfonyl)-O-[4-(4-pyridinyl)butyl]-
- N-(butylsulfonyl)-O-[4-(4-pyridinyl)butyl]-L-tyrosine
- N-(Butylsulfonyl)-O-[4-(4-pyridinyl)butyl]-L-tyrosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-Tyrosine, N-(butylsulfonyl)-O-[4-(4-pyridinyl)butyl]-
CAS:Formula:C22H30N2O5SPurity:98%Color and Shape:SolidMolecular weight:434.5490N-(n-Butanesulfonyl)-O-[4-(4-pyridinyl)-butyl]-(S)-tyrosine
CAS:Applications Tirofiban intermediate.
Formula:C22H30N2O5SColor and Shape:NeatMolecular weight:434.55N-Butanesulfonyl-O-[4-(4-pyridinyl)-butyl]-(S)-tyrosine
CAS:N-Butanesulfonyl-O-[4-(4-pyridinyl)-butyl]-(S)-tyrosine is a synthetic amino acid. It is soluble in water and forms hydrates. The yield of this reaction is 60%. The molecular weight of this compound is 233.3 g/mol. This compound has been shown to have proteolytic activity, which may be due to its ability to cleave peptide bonds in proteins. N-Butanesulfonyl-O-[4-(4-pyridinyl)-butyl]-(S)-tyrosine may also be used as an intermediate for the synthesis of other compounds, such as aminoglycosides and antibiotics. This chemical can be synthesized by reacting L-tyrosine with butanesulfonyl chloride in the presence of sodium hydroxide and an organic base, such as pyridine. The solvents used in this process are chloroform, dichFormula:C22H30N2O5SPurity:Min. 95%Color and Shape:PowderMolecular weight:434.55 g/molN-(n-Butanesulfonyl)-O-[4-(4-pyridinyl)-butyl]-(S)-tyrosine
CAS:Formula:C22H30N2O5SMolecular weight:434.55




