CAS 149507-36-8
:3-TRIFLUOROMETHYL-4-METHOXY-PHENYLBORONIC ACID
Description:
3-Trifluoromethyl-4-methoxy-phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a trifluoromethyl group, which enhances its lipophilicity and can influence its reactivity and biological activity. The methoxy group contributes to the compound's electronic properties, potentially affecting its reactivity in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is widely used in organic synthesis for forming carbon-carbon bonds. The presence of the boronic acid moiety makes it useful in medicinal chemistry and materials science, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the trifluoromethyl group can impart unique properties, such as increased metabolic stability and altered pharmacokinetics. Overall, this compound is of interest in various fields, including organic synthesis, medicinal chemistry, and materials science, due to its versatile reactivity and functionalization potential.
Formula:C8H8BF3O3
InChI:InChI=1/C8H8BF3O3/c1-15-7-3-2-5(9(13)14)4-6(7)8(10,11)12/h2-4,13-14H,1H3
SMILES:COc1ccc(cc1C(F)(F)F)B(O)O
Synonyms:- 4-Methoxy-3-Trifluoromethylphenylboronic Acid
- 4-Methoxy-3-(Trifluoromethyl)Benzeneboronic Acid
- 4-Methoxy-3-(trifluoromethyl)benzeneboronic acid 98%
- 4-Methoxy-3-(trifluoromethyl)benzeneboronicacid98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methoxy-3-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H8BF3O3Purity:min. 98.0 area%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:219.954-Methoxy-3-(trifluoromethyl)benzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H8BF3O3Purity:98%Molecular weight:219.95Boronic acid, B-[4-methoxy-3-(trifluoromethyl)phenyl]-
CAS:Formula:C8H8BF3O3Purity:96%Color and Shape:SolidMolecular weight:219.95354-Methoxy-3-(trifluoromethyl)benzeneboronic acid
CAS:4-Methoxy-3-(trifluoromethyl)benzeneboronic acidFormula:C8H8BF3O3Purity:98%Color and Shape: off white solidMolecular weight:219.95g/mol(4-Methoxy-3-(trifluoromethyl)phenyl)boronic acid
CAS:Formula:C8H8BF3O3Purity:95%Color and Shape:Liquid, No data available.Molecular weight:219.95




