CAS 149520-94-5

1H-Imidazole-4-carboxylicacid,2-amino-,ethylester

Description:

1H-Imidazole-4-carboxylic acid, 2-amino-, ethyl ester, with CAS number 149520-94-5, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid functional group and an amino group, contributing to its potential as a versatile building block in organic synthesis and pharmaceutical applications. The ethyl ester moiety enhances its solubility in organic solvents, making it suitable for various chemical reactions. The presence of both amino and carboxylic acid functionalities allows for the formation of various derivatives, which can be utilized in medicinal chemistry. Additionally, compounds with imidazole structures are known for their biological activity, including antimicrobial and antifungal properties. The compound's stability, reactivity, and ability to participate in hydrogen bonding are significant characteristics that influence its behavior in chemical reactions and interactions with biological systems. Overall, this compound is of interest in both synthetic chemistry and potential therapeutic applications.

Formula: C₆H₉N₃O₂

InChI: InChI=1/C6H9N3O2/c1-2-11-5(10)4-3-8-6(7)9-4/h3H,2H2,1H3,(H3,7,8,9)

SMILES: CCOC(=O)c1c[nH]c(=N)[nH]1

Synonyms:

• ethyl 2-amino-1H-imidazole-5-carboxylate
• Ethyl 2-amino-1H-imidazole-4-carboxylate

1H-Imidazole-5-carboxylic acid, 2-amino-, ethyl ester

CAS: 149520-94-5

Formula: C₆H₉N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 155.1546

Ref: IN-DA001LT5

Ethyl 2-amino-1H-imidazole-5-carboxylate

CAS: 149520-94-5

Ethyl 2-amino-1H-imidazole-5-carboxylate

Formula: C₆H₉N₃O₂

Purity: 97%

Color and Shape: pale reddish yellow powder

Molecular weight: 155.15456g/mol

Ref: 54-OR302532

Ethyl 2-amino-1H-imidazole-5-carboxylate

CAS: 149520-94-5

Formula: C₆H₉N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 155.157

Ref: 10-F049962