
CAS 149549-14-4
:N-[(1R)-1-Cyclohexylethyl]-4-phenyl-1-phthalazinamine
Description:
N-[(1R)-1-Cyclohexylethyl]-4-phenyl-1-phthalazinamine, with the CAS number 149549-14-4, is a chemical compound characterized by its complex structure, which includes a phthalazinamine core substituted with a cyclohexylethyl group and a phenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the phthalazine moiety, which is known for its biological activity. The stereochemistry indicated by the (1R) configuration suggests specific spatial arrangements that may influence the compound's interactions with biological targets. Additionally, the presence of both aliphatic and aromatic components in its structure may contribute to its solubility and reactivity profiles. Overall, this compound's unique characteristics make it a subject of interest for further research in various chemical and biological contexts.
Formula:C22H25N3
InChI:InChI=1S/C22H25N3/c1-16(17-10-4-2-5-11-17)23-22-20-15-9-8-14-19(20)21(24-25-22)18-12-6-3-7-13-18/h3,6-9,12-17H,2,4-5,10-11H2,1H3,(H,23,25)/t16-/m1/s1
InChI key:InChIKey=OJBBUQUNTTVULM-MRXNPFEDSA-N
SMILES:N([C@H](C)C1CCCCC1)C=2C3=C(C(=NN2)C4=CC=CC=C4)C=CC=C3
Synonyms:- 1-Phthalazinamine, N-(1-cyclohexylethyl)-4-phenyl-, (R)-
- 1-Phthalazinamine, N-[(1R)-1-cyclohexylethyl]-4-phenyl-
- MKC 963
- N-[(1R)-1-Cyclohexylethyl]-4-phenyl-1-phthalazinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
MKC-963 (R-isomer)
CAS:MKC-963 is a platelet aggregation inhibitor and autoinducer of CYP3A4.Formula:C22H25N3Color and Shape:SolidMolecular weight:331.45
