CymitQuimica logo

CAS 149598-64-1

:

({[(5S,6S)-5-{[(2S,3R,4S,5S,6R)-3,5-dihydroxy-6-methyl-4-{[(2S,3R,4S,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl]oxy}tetrahydro-2H-pyran-2-yl]oxy}-1,6,9,14-tetrahydroxy-3-methyl-8,13-dioxo-11-{[(2R,3S,4R,5S)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl]oxy}-

Description:
The chemical substance with the name provided and CAS number 149598-64-1 is a complex organic molecule characterized by multiple hydroxyl (-OH) groups and a series of tetrahydropyran rings. This structure indicates that it is likely a polyol, which typically exhibits high solubility in water due to the presence of these hydroxyl groups. The stereochemistry of the molecule, denoted by the specific configurations at various chiral centers, suggests that it may exhibit specific biological activity or interactions, potentially making it relevant in pharmaceutical applications. The presence of dioxo groups implies that it may participate in redox reactions or serve as a reactive intermediate in various chemical processes. Additionally, the intricate arrangement of functional groups and rings may contribute to its stability and reactivity, influencing its behavior in biological systems or chemical reactions. Overall, this compound's structural complexity and functional diversity suggest potential utility in medicinal chemistry or as a biochemical agent.
Formula:C42H45NO23
InChI:InChI=1/C42H45NO23/c1-10-3-16-24(32(55)21(10)39(60)43-7-20(47)48)23-14(29(52)37(16)65-42-36(59)38(26(49)11(2)63-42)66-41-35(58)31(54)19(46)9-62-41)6-15-25(33(23)56)28(51)13-4-12(5-17(44)22(13)27(15)50)64-40-34(57)30(53)18(45)8-61-40/h3-6,11,18-19,26,29-31,34-38,40-42,44-46,49,52-59H,7-9H2,1-2H3,(H,43,60)(H,47,48)/t11-,18+,19-,26+,29+,30-,31+,34+,35-,36-,37+,38+,40-,41+,42+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Pradimicin Tl

    CAS:
    Pradimicin T1 is an antibiotic with activity against filamentous fungi and yeast-like fungi (Pradimicin Tl).
    Formula:C42H45NO23
    Color and Shape:Solid
    Molecular weight:931.8

    Ref: TM-TN10436

    10mg
    To inquire
    50mg
    To inquire