CAS 1496-15-7
:2-(TRIFLUOROMETHYL)XANTHONE
Description:
2-(Trifluoromethyl)xanthone, with the CAS number 1496-15-7, is an organic compound belonging to the xanthone family, characterized by a xanthone core structure substituted with a trifluoromethyl group at the 2-position. This compound typically exhibits a yellow crystalline appearance and is known for its potential applications in various fields, including organic synthesis and materials science. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its electronic properties, making it a subject of interest in medicinal chemistry and photochemistry. 2-(Trifluoromethyl)xanthone can also exhibit fluorescence, which is valuable for applications in fluorescent probes and dyes. Its reactivity and stability can vary depending on the conditions, and it may participate in various chemical reactions, including electrophilic substitutions. As with many xanthones, it may also possess biological activities, although specific studies would be required to elucidate its pharmacological properties. Proper handling and safety measures should be observed due to its chemical nature.
Formula:C14H7F3O2
InChI:InChI=1/C14H7F3O2/c15-14(16,17)8-5-6-12-10(7-8)13(18)9-3-1-2-4-11(9)19-12/h1-7H
SMILES:c1ccc2c(c1)c(=O)c1cc(ccc1o2)C(F)(F)F
Synonyms:- 2-Trifluoromethyl-Xanthen-9-One
- 2-(Trifluoromethyl)Xanthone 97%
- 2-(trifluoromethyl)-9H-xanthen-9-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
9H-Xanthen-9-one, 2-(trifluoromethyl)-
CAS:Formula:C14H7F3O2Color and Shape:SolidMolecular weight:264.19942-(Trifluoromethyl)-9H-xanthen-9-one
CAS:2-(Trifluoromethyl)-9H-xanthen-9-one
Molecular weight:264.20g/mol

