CAS 149648-52-2
:7-Phenylcarbamoylheptanoic acid
Description:
7-Phenylcarbamoylheptanoic acid is an organic compound characterized by its structure, which includes a heptanoic acid backbone with a phenylcarbamoyl group at the seventh carbon position. This compound features both carboxylic acid and amide functional groups, contributing to its potential as a versatile intermediate in organic synthesis. The presence of the phenyl group enhances its hydrophobic characteristics, while the carboxylic acid group provides acidity and potential for hydrogen bonding. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions can be influenced by the steric and electronic properties of the phenyl group, which may affect solubility and reactivity. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 7-Phenylcarbamoylheptanoic acid represents a unique structure that may have applications in medicinal chemistry and materials science.
Formula:C14H19NO3
InChI:InChI=1/C14H19NO3/c16-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(17)18/h3-5,8-9H,1-2,6-7,10-11H2,(H,15,16)(H,17,18)
SMILES:C(CCCC(=O)O)CCC(=Nc1ccccc1)O
Synonyms:- 7-Phenylcarbamoyl-Heptanoic Acid
- 8-Oxo-8-(phenylamino)octanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Octanoic acid, 8-oxo-8-(phenylamino)-
CAS:Formula:C14H19NO3Purity:98%Color and Shape:SolidMolecular weight:249.30567-(Phenylcarbamoyl)heptanoic acid
CAS:7-(Phenylcarbamoyl)heptanoic acidFormula:C14H19NO3Purity:≥95%Color and Shape:SolidMolecular weight:249.31g/mol7-Phenylcarbamoylheptanoic acid
CAS:Formula:C14H19NO3Purity:98%Color and Shape:SolidMolecular weight:249.31Suberanilic Acid
CAS:Controlled ProductApplications An intermediate in the production of Suberoylanilide Hydroxamic Acid and other histone deacetylase inhibitors
References Dehmel, F., et al.: Bioorg. Med. Chem. Lett., 17, 4746 (2007), Herman, D., et al.: Nat. Chem. Biol., 3, 432 (2007),Formula:C14H19NO3Color and Shape:NeatMolecular weight:249.31



