CAS 149649-22-9
:Nafadotride
Description:
Nafadotride, identified by its CAS number 149649-22-9, is a chemical compound that belongs to the class of tricyclic compounds. It is primarily recognized for its application in the field of medicinal chemistry, particularly as a potential therapeutic agent. Nafadotride exhibits a unique molecular structure that contributes to its biological activity, often interacting with specific receptors or enzymes in the body. The compound is characterized by its moderate to high lipophilicity, which influences its absorption and distribution in biological systems. Additionally, Nafadotride may demonstrate a range of pharmacological effects, including anti-inflammatory or analgesic properties, depending on its mechanism of action. Safety and toxicity profiles are essential considerations in its development, as with any pharmaceutical compound. Overall, Nafadotride represents a significant interest in drug discovery, with ongoing research aimed at elucidating its full potential and applications in treating various medical conditions.
Formula:C22H27N3O2
InChI:InChI=1S/C22H27N3O2/c1-3-4-11-25-12-7-8-17(25)15-24-22(26)20-13-16(14-23)18-9-5-6-10-19(18)21(20)27-2/h5-6,9-10,13,17H,3-4,7-8,11-12,15H2,1-2H3,(H,24,26)
InChI key:InChIKey=IDZASIQMRGPBCQ-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C(C#N)=CC1C(NCC3N(CCCC)CCC3)=O)C=CC=C2
Synonyms:- 2-Naphthalenecarboxamide, N-[(1-butyl-2-pyrrolidinyl)methyl]-4-cyano-1-methoxy-
- N-[(1-butylpyrrolidin-2-yl)methyl]-4-cyano-1-methoxynaphthalene-2-carboxamide
- Nafadotride
- N-[(1-Butyl-2-pyrrolidinyl)methyl]-4-cyano-1-methoxy-2-naphthalenecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-Naphthalenecarboxamide, N-[(1-butyl-2-pyrrolidinyl)methyl]-4-cyano-1-methoxy-
CAS:Formula:C22H27N3O2Molecular weight:365.4687Nafadotride
CAS:Nafadotride is a dopamine D3 receptor antagonist.Formula:C22H27N3O2Color and Shape:SolidMolecular weight:365.47


