CymitQuimica logo

CAS 14965-96-9

:

(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexanamide (non-preferred name)

Description:
The chemical substance with the name "(2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexanamide" and CAS number "14965-96-9" is a hexosamine derivative characterized by the presence of five hydroxyl (-OH) groups and an amide functional group. This compound is a stereoisomer, indicating specific spatial arrangements of its chiral centers at positions 2, 3, 4, and 5, which contribute to its biological activity and interaction with other molecules. The presence of multiple hydroxyl groups suggests high polarity, which can influence its solubility in water and its ability to form hydrogen bonds. This compound is likely to be involved in various biochemical processes, potentially serving as a precursor in the synthesis of glycoproteins or glycolipids. Its structural features may also play a role in cellular recognition and signaling pathways. Overall, the unique configuration and functional groups of this substance make it significant in both chemical and biological contexts.
Formula:C6H13NO6
InChI:InChI=1/C6H13NO6/c7-6(13)5(12)4(11)3(10)2(9)1-8/h2-5,8-12H,1H2,(H2,7,13)/t2-,3+,4+,5-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.