CAS 1496511-51-3

2-Ethyl-2H-1,2,3-triazole-4-sulfonyl chloride

Description:

2-Ethyl-2H-1,2,3-triazole-4-sulfonyl chloride is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a sulfonyl chloride functional group, making it a reactive sulfonyl chloride derivative. It is typically used in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl-containing compounds. The presence of the ethyl group enhances its solubility and reactivity. As a sulfonyl chloride, it is known for its ability to react with amines, alcohols, and other nucleophiles, facilitating the formation of various derivatives. The compound is likely to be a solid at room temperature and may require careful handling due to its reactivity and potential to release hydrochloric acid upon hydrolysis. Safety precautions should be observed when working with this substance, as it can be corrosive and may pose health risks if inhaled or contacted with skin.

Formula: C₄H₆ClN₃O₂S

InChI: InChI=1S/C4H6ClN3O2S/c1-2-8-6-3-4(7-8)11(5,9)10/h3H,2H2,1H3

InChI key: InChIKey=MRXMYHDAQKAGAP-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=NN(CC)N=C1

Synonyms:

• 2H-1,2,3-Triazole-4-sulfonyl chloride, 2-ethyl-
• 2-Ethyl-2H-1,2,3-triazole-4-sulfonyl chloride

2-Ethyl-2H-1,2,3-triazole-4-sulfonyl chloride

CAS: 1496511-51-3

Versatile small molecule scaffold

Formula: C₄H₆ClN₃O₂S

Purity: Min. 95%

Molecular weight: 195.63 g/mol

Ref: 3D-WJC51151