CymitQuimica logo

CAS 14966-91-7

:

3-AMINO-6-PHENYLPYRIDAZINE

Description:
3-Amino-6-phenylpyridazine is an organic compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of an amino group at the 3-position and a phenyl group at the 6-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. It may also display basic properties due to the amino functionality. The phenyl substituent can enhance the compound's lipophilicity, potentially influencing its biological activity and interactions. 3-Amino-6-phenylpyridazine may be of interest in medicinal chemistry and pharmaceutical research, as derivatives of pyridazine are often explored for their potential therapeutic applications. Its reactivity can be attributed to the presence of the amino group, which can participate in various chemical reactions, including acylation and alkylation. Overall, this compound's structural features suggest it could serve as a valuable building block in the synthesis of more complex molecules.
Formula:C10H9N3
InChI:InChI=1/C10H9N3/c11-10-7-6-9(12-13-10)8-4-2-1-3-5-8/h1-7H,(H2,11,13)
InChI key:YTDZFWNQRRMELI-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1ccc(=N)[nH]n1
Synonyms:
  • 6-Phenyl-pyridazin-3-ylamine
  • Timtec-Bb Sbb005608
  • 6-Phenyl-3-pyridazinamine
  • 6-Phenylpyridazin-3-Amine
Found 4 products.