CAS 149669-44-3
:5-Methyl-3-(4-piperidinyl)-1H-indole
Description:
5-Methyl-3-(4-piperidinyl)-1H-indole, with the CAS number 149669-44-3, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a methyl group at the 5-position and a piperidine ring at the 3-position, contributing to its unique properties and potential biological activity. It is often studied in the context of medicinal chemistry due to its structural similarity to various pharmacologically active compounds. The presence of the piperidine moiety may enhance its interaction with biological targets, making it of interest in drug discovery and development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which are critical for its application in various chemical and pharmaceutical contexts. As with many indole derivatives, it may exhibit a range of biological activities, including potential effects on the central nervous system, although specific activity would depend on further empirical studies.
Formula:C14H18N2
InChI:InChI=1S/C14H18N2/c1-10-2-3-14-12(8-10)13(9-16-14)11-4-6-15-7-5-11/h2-3,8-9,11,15-16H,4-7H2,1H3
InChI key:InChIKey=GHSKCHSQKGGSLP-UHFFFAOYSA-N
SMILES:CC=1C=C2C(=CNC2=CC1)C3CCNCC3
Synonyms:- 1H-Indole, 5-methyl-3-(4-piperidinyl)-
- 4-(5-Methyl-3-indolyl)piperidine
- 5-Methyl-3-(4-piperidinyl)-1H-indole
- 5-Methyl-3-Piperidin-4-Yl-1H-Indole Hydrochloride
- 5-methyl-3-(4-piperidyl)-1H-indole hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Methyl-3-piperidin-4-yl-1H-indole hydrochloride
CAS:5-Methyl-3-piperidin-4-yl-1H-indole hydrochloride is a synthetic chemical that is used as a building block for the synthesis of other compounds. It is a versatile intermediate, having been shown to react with amines, alcohols, phenols, and thiols. 5-Methyl-3-piperidin-4-yl-1H-indole hydrochloride can be used in the manufacture of pharmaceuticals and agrochemicals. This compound has been found to be an effective reagent for the preparation of cyclic peptides and can be used as a building block for the synthesis of other compounds. When reacted with 2-(trimethylsilyl)ethanol, it produces a high quality complex compound.
Formula:C14H18N2·HClPurity:Min. 97 Area-%Color and Shape:PowderMolecular weight:250.77 g/mol

