CAS 149669-45-4

6-METHYL-3-PIPERIDIN-4-YL-1H-INDOLE

Description:

6-Methyl-3-piperidin-4-yl-1H-indole, with the CAS number 149669-45-4, is a chemical compound that features a complex structure combining an indole moiety with a piperidine ring. This compound is characterized by its nitrogen-containing heterocycles, which contribute to its potential biological activity. The presence of the methyl group at the 6-position of the indole and the piperidine ring at the 3-position suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems. Such compounds are often investigated for their pharmacological properties, including potential applications in treating neurological disorders. The molecular structure indicates that it may exhibit lipophilicity, which can affect its bioavailability and interaction with cellular membranes. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific properties and potential therapeutic applications.

Formula: C₁₄H₁₈N₂

InChI: InChI=1/C14H18N2/c1-10-2-3-12-13(9-16-14(12)8-10)11-4-6-15-7-5-11/h2-3,8-9,11,15-16H,4-7H2,1H3

SMILES: Cc1ccc2c(c[nH]c2c1)C1CCNCC1

Synonyms:

• 1H-indole, 6-methyl-3-(4-piperidinyl)-
• 6-Methyl-3-(piperidin-4-yl)-1H-indol

6-Methyl-3-(piperidin-4-yl)-1H-indole

CAS: 149669-45-4

Formula: C₁₄H₁₈N₂

Molecular weight: 214.3061

Ref: IN-DA001LX1

6-Methyl-3-(piperidin-4-yl)-1H-indole

CAS: 149669-45-4

Versatile small molecule scaffold

Formula: C₁₄H₁₈N₂

Purity: Min. 95%

Molecular weight: 214.31 g/mol

Ref: 3D-ZFA66945