CAS 149709-63-7: α-Ethyl (αS,γS)-γ-[(3-carboxy-1-oxopropyl)amino]-α-methyl[1,1′-biphenyl]-4-pentanoate
Description:α-Ethyl (αS,γS)-γ-[(3-carboxy-1-oxopropyl)amino]-α-methyl[1,1′-biphenyl]-4-pentanoate, with CAS number 149709-63-7, is a chemical compound that belongs to the class of amino acid derivatives. This substance features a complex structure characterized by a biphenyl moiety, which contributes to its unique physical and chemical properties. The presence of multiple functional groups, including a carboxylic acid and an amine, suggests that it may exhibit both hydrophilic and hydrophobic characteristics, influencing its solubility in various solvents. The stereochemistry indicated by the (αS,γS) configuration implies specific spatial arrangements that can affect biological activity and interactions with other molecules. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its potential applications could extend to areas such as medicinal chemistry and biochemistry, where understanding the interactions of such compounds is crucial for drug design and therapeutic efficacy.
Formula:C24H29NO5
InChI:InChI=1S/C24H29NO5/c1-3-30-24(29)17(2)15-21(25-22(26)13-14-23(27)28)16-18-9-11-20(12-10-18)19-7-5-4-6-8-19/h4-12,17,21H,3,13-16H2,1-2H3,(H,25,26)(H,27,28)/t17-,21-/m0/s1
InChI key:InChIKey=PYNXFZCZUAOOQC-UWJYYQICSA-N
SMILES:O=C(O)CCC(=O)NC(CC=1C=CC(=CC1)C=2C=CC=CC2)CC(C(=O)OCC)C
- Synonyms:
- [1,1′-Biphenyl]-4-pentanoic acid, γ-[(3-carboxy-1-oxopropyl)amino]-α-methyl-, ethyl ester, [S-(R*,R*)]-
- α-Ethyl (αS,γS)-γ-[(3-carboxy-1-oxopropyl)amino]-α-methyl[1,1′-biphenyl]-4-pentanoate
- [1,1′-Biphenyl]-4-pentanoic acid, γ-[(3-carboxy-1-oxopropyl)amino]-α-methyl-, α-ethyl ester, (αS,γS)-
![α-Ethyl (αS,γS)-γ-[(3-carboxy-1-oxopropyl)amino]-α-methyl[1,1′-biphenyl]-4-pentanoate](https://static.cymitquimica.com/cas-image/16181-a-ethyl-as-gs-g-3-carboxy-1-oxopropyl-amino-a-methyl-11-biphenyl-4-pentanoate.png)
![[1,1'-Biphenyl]-4-pentanoic acid, γ-[(3-carboxy-1-oxopropyl)amino]-α-methyl-, α-ethyl ester, (αS,γ…](https://static.cymitquimica.com/products/IN/thumb/DA001LYF.jpg)
![4-(((2S,4S)-1-([1,1'-BIPHENYL]-4-YL)-5-ETHOXY-4-METHYL-5-OXOPENTAN-2-YL)AMINO)-4-OXOBUTANOIC ACID](https://static.cymitquimica.com/products/10/thumb/F826786.jpg)
