CAS 149739-65-1
:5-(3-BROMO-PHENYL)-1H-PYRAZOLE
Description:
5-(3-Bromo-phenyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom on the phenyl group at the 3-position introduces significant electrophilic properties, making it a useful intermediate in various chemical syntheses. This compound typically exhibits moderate solubility in organic solvents and may show limited solubility in water due to its hydrophobic phenyl group. Its structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrazole derivatives are known for their biological activity, including anti-inflammatory and analgesic properties. The compound's reactivity can be influenced by the bromine substituent, which can participate in nucleophilic substitution reactions. Additionally, the presence of the pyrazole ring can facilitate coordination with metal ions, making it of interest in coordination chemistry. Overall, 5-(3-bromo-phenyl)-1H-pyrazole is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C9H7BrN2
InChI:InChI=1/C9H7BrN2/c10-8-3-1-2-7(6-8)9-4-5-11-12-9/h1-6H,(H,11,12)
SMILES:c1cc(cc(c1)Br)c1cc[nH]n1
Synonyms:- 1H-pyrazole, 3-(3-bromophenyl)-
- 1H-Pyrazole, 5-(3-bromophenyl)-
- 3-(3-Bromophenyl)-1H-pyrazole
- 5-(3-Bromophenyl)-1H-pyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(3-Bromophenyl)-1H-pyrazole, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H7BrN2Purity:98%Molecular weight:223.071H-Pyrazole, 3-(3-bromophenyl)-
CAS:Formula:C9H7BrN2Purity:98%Color and Shape:SolidMolecular weight:223.06933-(3-Bromophenyl)-1H-pyrazole
CAS:3-(3-Bromophenyl)-1H-pyrazolePurity:≥95%Color and Shape:SolidMolecular weight:223.07g/mol5-(3-Bromophenyl)-1H-pyrazole
CAS:5-(3-Bromophenyl)-1H-pyrazoleFormula:C9H7BrN2Purity:98%Color and Shape: brown crystalline solidMolecular weight:223.07g/mol5-(3-Bromophenyl)-1H-pyrazole
CAS:Formula:C9H7BrN2Purity:95%Color and Shape:SolidMolecular weight:223.073



