CAS 149777-00-4: TETRAHYDROPYRAN-4,4-DICARBOXYLIC ACID DIMETHYL ESTER

Description:Tetrahydropyran-4,4-dicarboxylic acid dimethyl ester is an organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features two carboxylic acid groups that are esterified with methyl groups, resulting in dimethyl ester functionality. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of multiple functional groups contributes to its reactivity, making it useful in various chemical syntheses and applications, particularly in organic chemistry and medicinal chemistry. The compound may exhibit polar characteristics due to the carboxylate groups, influencing its solubility in polar solvents. Additionally, it may participate in reactions such as esterification, hydrolysis, and condensation, making it a versatile intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula:C₉H₁₄O₅

InChI:InChI=1/C9H14O5/c1-12-7(10)9(8(11)13-2)3-5-14-6-4-9/h3-6H2,1-2H3

Synonyms:
Dimethyl Tetrahydropyran-4,4-Dicarboxylate
Tetrahydropyran-4,4-dicarboxylicAcidDimethylEst
dimethyl tetrahydro-4H-pyran-4,4-dicarboxylate

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Dimethyl Tetrahydropyran-4,4-dicarboxylate REF: 3B-T1825CAS: 149777-00-4	>98.0%(GC)	128.00 €~414.00 €	Mon 14 Apr 25
4H-Pyran-4,4-dicarboxylic acid, tetrahydro-, 4,4-dimethyl ester REF: IN-DA001M0BCAS: 149777-00-4	95%	27.00 €~511.00 €	Mon 21 Apr 25
Tetrahydropyran-4,4-dicarboxylic acid dimethyl ester REF: 54-OR315528CAS: 149777-00-4	98+%	32.00 €~5,399.00 €	Tue 22 Apr 25
Dimethyl dihydro-2H-pyran-4,4(3H)-dicarboxylate REF: 10-F233624CAS: 149777-00-4	95.0%	To inquire	Fri 02 May 25
Dimethyl tetrahydropyran-4,4-dicarboxylate REF: 3D-ZFA77700CAS: 149777-00-4	Min. 95%	- - -	Discontinued product