CAS 149777-84-4: 4,4,5,5-Tetramethyl-2-[(1E)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane
Description:4,4,5,5-Tetramethyl-2-[(1E)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane, with CAS number 149777-84-4, is a boron-containing organic compound characterized by its dioxaborolane structure, which features a five-membered ring containing boron and oxygen atoms. This compound exhibits unique reactivity due to the presence of the boron atom, making it useful in various organic synthesis applications, particularly in the formation of carbon-carbon bonds. The presence of the tetramethyl and phenyl substituents contributes to its hydrophobic nature and can influence its solubility in organic solvents. Additionally, the compound may exhibit interesting optical properties due to the conjugated system formed by the ethenyl group and the aromatic ring. Its stability and reactivity can be affected by environmental conditions such as temperature and moisture. Overall, this compound is of interest in the fields of organic chemistry and materials science, particularly in the development of new synthetic methodologies and functional materials.
Formula:C15H21BO2
InChI:InChI=1S/C15H21BO2/c1-12-6-8-13(9-7-12)10-11-16-17-14(2,3)15(4,5)18-16/h6-11H,1-5H3/b11-10+
InChI key:InChIKey=HHBWKASJNTZJLB-ZHACJKMWSA-N
SMILES:O1B(OC(C)(C)C1(C)C)C=CC2=CC=C(C=C2)C
- Synonyms:
- (E)-4,4,5,5-Tetramethyl-2-(4-methylstyryl)-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[(1E)-2-(4-methylphenyl)ethenyl]-
- 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[2-(4-methylphenyl)ethenyl]-, (E)-
- 4,4,5,5-Tetramethyl-2-[(1E)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane
- 4,4,5,5-tetramethyl-2-[(E)-2-(4-methylphenyl)ethenyl]-1,3,2-dioxaborolane

4-Methyl-β-styrylboronic acid pinacol ester, 98%
Ref: 02-L19698
1g | To inquire | ||
250mg | To inquire |

1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[(1E)-2-(4-methylphenyl)ethenyl]-
Ref: IN-DA001M09
1g | 191.00 € | ||
100mg | 72.00 € | ||
250mg | 109.00 € |

Ref: 54-OR361427
1g | 410.00 € | ||
5g | 1,267.00 € | ||
25g | 4,434.00 € | ||
100mg | 109.00 € | ||
250mg | 178.00 € |

2-[2-(4-Methylphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Ref: 3D-ZFA77784
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |