CAS 14980-92-8
:Tetradecanoic acid, 2-bromo-, ethyl ester
Description:
Tetradecanoic acid, 2-bromo-, ethyl ester, also known as ethyl 2-bromotetradecanoate, is an organic compound characterized by its ester functional group derived from tetradecanoic acid (a saturated fatty acid) and 2-bromopropanol. This compound typically appears as a colorless to pale yellow liquid with a characteristic fatty odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its long hydrophobic carbon chain. The presence of the bromine atom introduces unique reactivity, making it useful in various organic synthesis applications, particularly in the preparation of brominated compounds. Its molecular structure contributes to its physical properties, including a relatively high boiling point compared to smaller esters. Tetradecanoic acid, 2-bromo-, ethyl ester is utilized in chemical research and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. As with many brominated compounds, it is important to handle it with care due to potential toxicity and environmental concerns associated with brominated organic compounds.
Formula:C16H31BrO2
InChI:InChI=1S/C16H31BrO2/c1-3-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19-4-2/h15H,3-14H2,1-2H3
InChI key:InChIKey=JQQZIRFEGUUJBP-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCC)(C(OCC)=O)Br
Synonyms:- Ethyl α-bromomyristate
- Ethyl 2-bromomyristate
- α-Bromomyristic acid ethyl ester
- Ethyl 2-bromotetradecanoate
- Tetradecanoic acid, 2-bromo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
