CAS 149806-06-4
:6-Bromo-3-pyridinecarboxaldehyde
Description:
6-Bromo-3-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position and an aldehyde functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is soluble in common organic solvents, making it useful in various chemical reactions, including nucleophilic additions and condensation reactions. The aldehyde group allows for further functionalization, enabling the synthesis of more complex molecules. Additionally, 6-Bromo-3-pyridinecarboxaldehyde may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and storage are essential due to potential toxicity and reactivity, particularly concerning the bromine atom, which can participate in substitution reactions.
Formula:C6H4BrNO
InChI:InChI=1S/C6H4BrNO/c7-6-2-1-5(4-9)3-8-6/h1-4H
InChI key:InChIKey=PVUKGNBRJFTFNJ-UHFFFAOYSA-N
SMILES:C(=O)C=1C=CC(Br)=NC1
Synonyms:- 2-Bromo-5-Pyridinecarboxaldehyde
- 2-Bromopyridine-5-Carbaldehyde
- 2-Bromopyridine-5-Carboxaldehyde
- 3-Formyl-6-bromopyridine
- 3-Pyridinecarboxaldehyde, 6-bromo-
- 6-Bromo-3-Pyridinecarboxaldehyde
- 6-Bromo-Pyridine-3-Carbaldehyde
- 6-Bromonicotinaldehyde
- 6-Bromopyridine-3-Carboxaldehyde
- 6-Bromopyridine-3-carbaldehyde
- 2-Bromo-5-formylpyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
6-Bromo-3-pyridinecarboxaldehyde
CAS:Formula:C6H4BrNOPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:186.012-Bromopyridine-5-carboxaldehyde, 95%
CAS:A useful synthetic intermediate. 6-Bromonicotinaldehyde is used in wittig reaction. Hydrodehalogenation of 6-bromonicotinaldehyde to produce alcohol. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may
Formula:C6H4BrNOPurity:95%Molecular weight:186.013-Pyridinecarboxaldehyde, 6-bromo-
CAS:Formula:C6H4BrNOPurity:98%Color and Shape:SolidMolecular weight:186.0061Ref: IN-DA001M1D
1g26.00€5g30.00€10g34.00€1kgTo inquire25g60.00€50g96.00€100g141.00€250g249.00€500g633.00€6-Bromonicotinaldehyde
CAS:6-BromonicotinaldehydeFormula:C6H4BrNOPurity:97%Color and Shape: pale yellow solidMolecular weight:186.01g/molRef: 10-F040403
1g12.00€5g14.00€10g23.00€1kg860.00€20g36.00€25g40.00€100g122.00€250g279.00€500g513.00€6-Bromopyridine-3-carboxaldehyde
CAS:Controlled ProductFormula:C6H4BrNOColor and Shape:NeatMolecular weight:186.016-Bromopyridine-3-carboxaldehyde
CAS:6-Bromopyridine-3-carboxaldehyde (6-BPAR) is a synthetic compound that binds to copper ions and has been shown to have inhibitory activities against trifluoroacetic acid, calcium carbonate, optical properties, and low energy. 6-BPAR also has an aldehyde group and hydroxamic acid group. This chemical can be used as a catalyst for the hydrogenation reduction of metal ions such as chloride or formyl groups.Formula:C6H4BrNOPurity:Min. 95%Color and Shape:White To Dark Red Or Brown SolidMolecular weight:186.01 g/mol









