CAS 14982-12-8: 17B-estradiol 3-(B-D-glucuronide)*sodium
Description:17B-estradiol 3-(B-D-glucuronide) sodium, with the CAS number 14982-12-8, is a conjugated form of the natural estrogen 17B-estradiol. This compound is characterized by the presence of a glucuronic acid moiety, which enhances its solubility and facilitates its excretion from the body. As a sodium salt, it is typically more soluble in aqueous solutions, making it suitable for various biological and pharmaceutical applications. The glucuronidation process, which involves the attachment of glucuronic acid, is a common metabolic pathway for steroid hormones, aiding in their detoxification and elimination. This compound is often studied in the context of hormone metabolism, endocrine function, and its role in various physiological processes. Its characteristics include being a polar molecule due to the glucuronide group, which influences its interaction with biological systems. Additionally, it may exhibit different pharmacokinetic properties compared to its parent compound, 17B-estradiol, particularly in terms of absorption, distribution, metabolism, and excretion.
Formula:C24H32NaO8
InChI:InChI=1/C24H32O8.Na/c1-24-9-8-14-13-5-3-12(10-11(13)2-4-15(14)16(24)6-7-17(24)25)31-23-20(28)18(26)19(27)21(32-23)22(29)30;/h3,5,10,14-21,23,25-28H,2,4,6-9H2,1H3,(H,29,30);
- Synonyms:
- Hexopyranosiduronic Acid, 17-Hydroxyestra-1,3,5(10)-Trien-3-Yl, Monosodium Salt