CAS 149834-58-2
:N1-(Triphenylmethyl)-1,6-hexanediamine
Description:
N1-(Triphenylmethyl)-1,6-hexanediamine, with the CAS number 149834-58-2, is an organic compound characterized by its structure, which includes a hexanediamine backbone substituted with a triphenylmethyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the bulky triphenylmethyl group contributes to its steric hindrance, which can influence its reactivity and solubility in various solvents. It may be used in organic synthesis, particularly in the development of polymers or as a ligand in coordination chemistry. The compound's physical properties, such as melting point and solubility, can vary based on its purity and the specific conditions under which it is handled. Additionally, due to the presence of amine functional groups, it may participate in various chemical reactions, including acylation and alkylation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C25H30N2
InChI:InChI=1S/C25H30N2/c26-20-12-1-2-13-21-27-25(22-14-6-3-7-15-22,23-16-8-4-9-17-23)24-18-10-5-11-19-24/h3-11,14-19,27H,1-2,12-13,20-21,26H2
InChI key:InChIKey=JUCAVZCEBDOYJO-UHFFFAOYSA-N
SMILES:C(NCCCCCCN)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 1,6-Hexanediamine, N-(triphenylmethyl)-
- N1-(Triphenylmethyl)-1,6-hexanediamine
- 1,6-Hexanediamine, N1-(triphenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
