CAS 14984-26-0

2-Vinylbenzimidazole

Description:

2-Vinylbenzimidazole is an organic compound characterized by the presence of both a vinyl group and a benzimidazole moiety. It typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. The compound features a vinyl group (-CH=CH2) attached to the nitrogen-containing heterocyclic benzimidazole structure, which contributes to its reactivity and potential applications in polymer chemistry and as a monomer in the synthesis of various copolymers. 2-Vinylbenzimidazole is known for its ability to undergo polymerization, making it useful in the production of specialty polymers and materials with specific properties. Additionally, it exhibits good thermal stability and can participate in various chemical reactions, including cross-linking and copolymerization. Its unique structure allows for potential applications in fields such as pharmaceuticals, coatings, and adhesives. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₉H₈N₂

InChI: InChI=1S/C9H8N2/c1-2-9-10-7-5-3-4-6-8(7)11-9/h2-6H,1H2,(H,10,11)

InChI key: InChIKey=YRPYTFXEHXXYQW-UHFFFAOYSA-N

SMILES: C(=C)C=1NC=2C(N1)=CC=CC2

Synonyms:

• 1H-Benzimidazole, 2-ethenyl-
• 2-Ethenyl-1H-1,3-benzodiazole
• 2-Vinyl-1H-Benzimidazole
• 2-Vinylbenzimidazole
• 2-ethenyl-1H-benzimidazole
• Benzimidazole, 2-vinyl-

2-Vinyl-1H-benzo[d]imidazole

CAS: 14984-26-0

Formula: C₉H₈N₂

Purity: 95%

Molecular weight: 144.1732

Ref: IN-DA001M26

2-Vinyl-1H-benzo[d]imidazole

CAS: 14984-26-0

2-Vinyl-1H-benzo[d]imidazole

Purity: 95% (stabilized with TBC)

Molecular weight: 144.18g/mol

Ref: 54-OR1066116

2-vinyl-1H-benzimidazole

CAS: 14984-26-0

Formula: C₉H₈N₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 144.177

Ref: 10-F310242

2-Vinyl-1H-benzimidazole

CAS: 14984-26-0

2-Vinyl-1H-benzimidazole is a polymerizable monomer with reactive groups. The proton spectrum of the n-oxide has been reported and the polymerization technique has been investigated. This compound can be copolymerized with other polymers, such as polypropylene or polyethylene, to produce new materials for use in medical devices, packaging, and construction materials. 2-Vinyl-1H-benzimidazole reacts through elimination reactions and intramolecular hydrogen transfer to produce benzimidazole derivatives.

Formula: C₉H₈N₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 144.17 g/mol

Ref: 3D-FV124897