CAS 149849-92-3

2-Chloropyrimidine-4-carboxylic acid

Description:

2-Chloropyrimidine-4-carboxylic acid is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom and a carboxylic acid group. The presence of the chlorine atom at the second position and the carboxylic acid at the fourth position of the pyrimidine ring contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid functionality. It exhibits acidic behavior, allowing it to participate in various chemical reactions, including esterification and amidation. The compound is of interest in medicinal chemistry and agrochemicals, as derivatives of pyrimidine are often explored for their biological activities. Additionally, its reactivity can be influenced by the electron-withdrawing nature of the chlorine substituent, which can affect the compound's overall stability and reactivity in synthetic applications. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₅H₃ClN₂O₂

InChI: InChI=1/C5H3ClN2O2/c6-5-7-2-1-3(8-5)4(9)10/h1-2H,(H,9,10)

SMILES: c1cnc(Cl)nc1C(=O)O

Synonyms:

• 2-Chloropyrimidine-4-carboxylicacid
• 4-Pyrimidinecarboxylic acid, 2-chloro-
• Acide 2-Chloropyrimidine-4-Carboxylique

4-Pyrimidinecarboxylic acid, 2-chloro-

CAS: 149849-92-3

Formula: C₅H₃ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 158.5425

Ref: IN-DA001M1M

2-Chloropyrimidine-4-carboxylic acid

CAS: 149849-92-3

2-Chloropyrimidine-4-carboxylic acid

Formula: C₅H₃ClN₂O₂

Purity: 96%

Color and Shape: yellow solid

Molecular weight: 158.54g/mol

Ref: 54-OR60023

2-Chloropyrimidine-4-carboxylic acid

CAS: 149849-92-3

Formula: C₅H₃ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 158.54

Ref: 10-F066259