CAS 1499-17-8
:1,3,2-Benzodioxaphosphole, 2-chloro-, 2-oxide
Description:
1,3,2-Benzodioxaphosphole, 2-chloro-, 2-oxide, with CAS number 1499-17-8, is a heterocyclic compound featuring a phosphorus atom integrated into a benzodioxaphosphole ring structure. This compound is characterized by its unique bicyclic framework, which includes both oxygen and chlorine substituents. The presence of the phosphorus atom contributes to its potential reactivity and applications in various chemical processes, particularly in the field of organophosphorus chemistry. It may exhibit properties such as moderate stability under ambient conditions, but its reactivity can be influenced by the chlorine atom, which can participate in nucleophilic substitution reactions. Additionally, the compound may display interesting electronic properties due to the conjugation within the aromatic system. Its applications could extend to areas such as agrochemicals, pharmaceuticals, or materials science, where phosphorus-containing compounds are often utilized for their functional properties. Safety and handling considerations are essential, as with many organophosphorus compounds, due to potential toxicity and environmental impact.
Formula:C6H4ClO3P
InChI:InChI=1/C6H4ClO3P/c7-11(8)9-5-3-1-2-4-6(5)10-11/h1-4H
InChI key:InChIKey=KMWSGKPLIWNTEF-UHFFFAOYSA-N
SMILES:ClP1(=O)OC=2C(O1)=CC=CC2
Synonyms:- 1,2-Phenylene phosphorochloridate
- 1,2-Phenylene phosphorochloridate ((C<sub>6</sub>H<sub>4</sub>O<sub>2</sub>)ClPO)
- 1,3,2-Benzodioxaphosphole, 2-chloro-, 2-oxide
- 2-Chloro-1,3,2-Benzodioxaphosphole 2-Oxide
- 2-Chloro-1,3-dioxa-2-phosphaindan 2-oxide
- 2-Chloro-2-oxobenzo-1,3,2-dioxaphosphole
- 2-Chloro-2H-1,3,2λ5-benzodioxaphosphol-2-one
- 2-Chlorobenzo[d][1,3,2]dioxaphosphole 2-oxide
- Catechol cyclophosphorochloridate
- O,O-(o-Phenylene) chlorophosphate
- Phosphorochloridic acid, cyclic o-phenylene ester
- Pyrocatechol, cyclic phosphorochloridate
- o-Phenylene chlorophosphate
- 1,2-Phenylene phosphorochloridate ((C6H4O2)ClPO)
- o-Phenylene phosphorochloridate
- 1,2-PHENYLENE PHOSPHOROCHLORIDATE, TECH.
- 8-chloro-7,9-dioxa-8$l^{5}-phosphabicyclo[4.3.0]nona-1,3,5-triene 8-oxide
- 1,2-PHENYLENE CHLOROPHOSPHATE
- 2-Chloro-1,3,2-benzodioxaphosphole 2-oxide, o-Phenylene chlorophosphate
- 2-Chloro-2-oxo-1,3,2-benzodioxaphosphole
- 3,2-benzodioxaphosphole,2-chloro-2-oxide
- o-Phenylene phosphorochloridate technical grade
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Chlorobenzo[d][1,3,2]dioxaphosphole 2-oxide
CAS:Formula:C6H4ClO3PColor and Shape:LiquidMolecular weight:190.5209
